loading...| Preferred Name |
serotonin |
|
| Synonyms |
SEROTONIN Serotonin 3-(2-aminoethyl)-1H-indol-5-ol serotonine thrombotonin 5-hydroxy-tryptamine 3-(2-azanylethyl)-1H-indol-5-ol Enteramine 3-(b-Aminoethyl)-5-hydroxyindole 3-(2-Aminoethyl)-1H-indol-5-ol Enteramin 5-Hydroxy-3-(b-aminoethyl)indole 5-HTA thrombocytin C10H12N2O 5-Hydroxyltryptamine Antemovis DS substance 5-Hydroxytriptamine NCCc1c[nH]c2ccc(O)cc12 5-HT 5-Hydroxytryptamine QZAYGJVTTNCVMB-UHFFFAOYSA-N Antemoqua 3-(2-Aminoethyl)indol-5-ol InChI=1S/C10H12N2O/c11-4-3-7-6-12-10-2-1-8(13)5-9(7)10/h1-2,5-6,12-13H,3-4,11H2 Hippophaine |
|
| Definitions |
A primary amino compound that is the 5-hydroxy derivative of tryptamine. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_28790 |
|
| database_cross_reference |
CiteXplore:18593914 CiteXplore:2459577 CiteXplore:12912814 Beilstein:143524 CiteXplore:1691117 Reaxys:143524 CiteXplore:16515859 CiteXplore:16412483 Wikipedia:Serotonin CiteXplore:16366421 ChemIDplus:50-67-9 CiteXplore:16289360 CiteXplore:2580417 CiteXplore:8884658 CiteXplore:9849813 CiteXplore:16939882 CiteXplore:16580588 PDBeChem:SRO CiteXplore:22770225 HMDB:HMDB00259 KNApSAcK:C00001429 CiteXplore:12834252 CiteXplore:16047543 CiteXplore:16842443 MetaCyc:SEROTONIN Gmelin:1861995 KEGG COMPOUND:50-67-9 CiteXplore:9931050 CiteXplore:16516555 CiteXplore:16435178 CiteXplore:24136337 CiteXplore:21939218 CiteXplore:16884454 CiteXplore:10367709 CiteXplore:16652315 KEGG COMPOUND:C00780 |
|
| definition |
A primary amino compound that is the 5-hydroxy derivative of tryptamine. |
|
| has_alternative_id |
CHEBI:1420 CHEBI:26652 CHEBI:49894 |
|
| has_exact_synonym |
SEROTONIN Serotonin 3-(2-aminoethyl)-1H-indol-5-ol |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
serotonine thrombotonin 5-hydroxy-tryptamine 3-(2-azanylethyl)-1H-indol-5-ol Enteramine 3-(b-Aminoethyl)-5-hydroxyindole 3-(2-Aminoethyl)-1H-indol-5-ol Enteramin 5-Hydroxy-3-(b-aminoethyl)indole 5-HTA thrombocytin C10H12N2O 5-Hydroxyltryptamine Antemovis DS substance 5-Hydroxytriptamine NCCc1c[nH]c2ccc(O)cc12 5-HT 5-Hydroxytryptamine QZAYGJVTTNCVMB-UHFFFAOYSA-N Antemoqua 3-(2-Aminoethyl)indol-5-ol InChI=1S/C10H12N2O/c11-4-3-7-6-12-10-2-1-8(13)5-9(7)10/h1-2,5-6,12-13H,3-4,11H2 Hippophaine |
|
| id |
CHEBI:28790 |
|
| imported from | ||
| label |
serotonin |
|
| notation |
CHEBI:28790 |
|
| prefixIRI |
CHEBI:28790 |
|
| prefLabel |
serotonin |
|
| subClassOf |
This ontology integrates with OntoloBridge, allowing community users to suggest additions to the public ontology. Complete the template below to submit a term request directly to the ontology maintainer.
Term Label (required)
Suggested term name. If a term can be described with multiple synonyms, only list the preferred name here.
Term description (required)
A brief definition, description, or usage of your suggested term. Additional term synonyms may be listed in this section.
Superclass (required)
The parent term of the suggested term. The parent term should be an existing entry of the current ontology. The superclass can be selected directly from Bioportal's Classes tree viewer.
References (optional)
Provide evidence for the existence of the requested term such as Pubmed IDs of papers or links to other resources that describe the term.
Justification (optional)
Provide any additional information about the requested term here.