loading...| Preferred Name |
Terbutaline |
|
| Synonyms |
5-[2-(tert-butylamino)-1-hydroxyethyl]benzene-1,3-diol terbutalina terbutaline terbutalinum |
|
| Definitions |
A member of the class of phenylethanolamines that is catechol substituted at position 5 by a 2-(tert-butylamino)-1-hydroxyethyl group. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_9449 |
|
| charge |
0 |
|
| database_cross_reference |
PMID:8298802 PMID:9596106 PMID:12423672 PMID:23325598 PMID:22813780 Wikipedia:Terbutaline PMID:12569076 PMID:35802964 PMID:22988932 HMDB:HMDB0015009 PMID:21996060 PMID:22765375 Reaxys:2370513 PMID:23283786 PMID:23126237 KEGG:D08570 Drug_Central:2598 PMID:36715198 PMID:22363704 PMID:36227333 PMID:21618259 DrugBank:DB00871 PMID:23299764 PMID:22872661 PMID:23075357 PMID:22310877 PMID:22767151 PMID:36808376 Patent:WO2011112499 KEGG:C07129 PMID:22782385 PMID:23204625 PMID:23341043 CAS:23031-25-6 |
|
| definition |
A member of the class of phenylethanolamines that is catechol substituted at position 5 by a 2-(tert-butylamino)-1-hydroxyethyl group. |
|
| formula |
C12H19NO3 |
|
| has role |
http://purl.obolibrary.org/obo/CHEBI_35524 http://purl.obolibrary.org/obo/CHEBI_35526 http://purl.obolibrary.org/obo/CHEBI_38462 http://purl.obolibrary.org/obo/CHEBI_66993 http://purl.obolibrary.org/obo/CHEBI_35522 |
|
| has_exact_synonym |
5-[2-(tert-butylamino)-1-hydroxyethyl]benzene-1,3-diol |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
terbutalina terbutaline terbutalinum |
|
| has_RxCUI |
10368 |
|
| id |
CHEBI:9449 |
|
| in_subset | ||
| inchi |
InChI=1S/C12H19NO3/c1-12(2,3)13-7-11(16)8-4-9(14)6-10(15)5-8/h4-6,11,13-16H,7H2,1-3H3 |
|
| inchikey |
XWTYSIMOBUGWOL-UHFFFAOYSA-N |
|
| is_bearer_of | ||
| label |
Terbutaline terbutaline |
|
| mass |
225.28420 |
|
| monoisotopicmass |
225.13649 |
|
| notation |
CHEBI:9449 |
|
| prefLabel |
Terbutaline |
|
| smiles |
CC(C)(C)NCC(O)c1cc(O)cc(O)c1 |
|
| subClassOf |