Preferred Name |
oxcarbazepine |
|
Synonyms |
10-oxo-10,11-dihydro-5H-dibenzo[b,f]azepine-5-carboxamide Oxcarbazepine 10,11-Dihydro-10-oxo-5H-dibenz(b,f)azepine-5-carboxamide oxcarbazepinum oxcarbazepine oxcarbazepina |
|
Definitions |
A dibenzoazepine derivative, having a carbamoyl group at the ring nitrogen, substituted with an oxo group at C-4 of the azepeine ring which is also hydrogenated at C-4 and C-5. It is a anticholinergic anticonvulsant and mood stabilizing drug, used primarily in the treatment of epilepsy. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_7824 |
|
charge |
0 |
|
database_cross_reference |
Drug_Central:2017 PMID:21924464 LINCS:LSM-5219 CAS:28721-07-5 KEGG:C07492 KEGG:D00533 |
|
definition |
A dibenzoazepine derivative, having a carbamoyl group at the ring nitrogen, substituted with an oxo group at C-4 of the azepeine ring which is also hydrogenated at C-4 and C-5. It is a anticholinergic anticonvulsant and mood stabilizing drug, used primarily in the treatment of epilepsy. |
|
formula |
C15H12N2O2 |
|
has part | ||
has role | ||
has_exact_synonym |
10-oxo-10,11-dihydro-5H-dibenzo[b,f]azepine-5-carboxamide Oxcarbazepine |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
10,11-Dihydro-10-oxo-5H-dibenz(b,f)azepine-5-carboxamide oxcarbazepinum oxcarbazepine oxcarbazepina |
|
has_RxCUI |
32624 |
|
id |
CHEBI:7824 |
|
in_subset | ||
inchi |
InChI=1S/C15H12N2O2/c16-15(19)17-12-7-3-1-5-10(12)9-14(18)11-6-2-4-8-13(11)17/h1-8H,9H2,(H2,16,19) |
|
inchikey |
CTRLABGOLIVAIY-UHFFFAOYSA-N |
|
is_bearer_of | ||
label |
oxcarbazepine |
|
mass |
252.26800 |
|
monoisotopicmass |
252.08988 |
|
notation |
CHEBI:7824 |
|
prefLabel |
oxcarbazepine |
|
smiles |
NC(=O)N1c2ccccc2CC(=O)c2ccccc12 |
|
subClassOf |