Preferred Name |
Methenamine |
|
Synonyms |
hexamethylenetetramine 1,3,5,7-tetraazaadamantane 1,3,5,7-tetraazatricyclo[3.3.1.1(3,7)]decane methenaminum hexamethylenamine Hexamethylentetramin hexamethylene tetramine methenamine hexamethylentetraminum HMT HMTA Uritone Urotropin hexamine hexaminum metenamina |
|
Definitions |
A polycyclic cage that is adamantane in which the carbon atoms at positions 1, 3, 5 and 7 are replaced by nitrogen atoms. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_6824 |
|
charge |
0 |
|
database_cross_reference |
PMID:13186006 Patent:US2762799 Patent:US2762800 LINCS:LSM-5440 KEGG:D00393 Wikipedia:Methenamine PMID:24641608 Beilstein:2018 Drug_Central:3344 Gmelin:26964 Reaxys:2018 CAS:100-97-0 HMDB:HMDB0029598 PMID:22365691 |
|
definition |
A polycyclic cage that is adamantane in which the carbon atoms at positions 1, 3, 5 and 7 are replaced by nitrogen atoms. |
|
formula |
C6H12N4 |
|
has role | ||
has_exact_synonym |
hexamethylenetetramine 1,3,5,7-tetraazaadamantane |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
1,3,5,7-tetraazatricyclo[3.3.1.1(3,7)]decane methenaminum hexamethylenamine Hexamethylentetramin hexamethylene tetramine methenamine hexamethylentetraminum HMT HMTA Uritone Urotropin hexamine hexaminum metenamina |
|
has_RxCUI |
6832 |
|
id |
CHEBI:6824 |
|
in_subset | ||
inchi |
InChI=1S/C6H12N4/c1-7-2-9-4-8(1)5-10(3-7)6-9/h1-6H2 |
|
inchikey |
VKYKSIONXSXAKP-UHFFFAOYSA-N |
|
label |
hexamethylenetetramine Methenamine |
|
mass |
140.18644 |
|
monoisotopicmass |
140.10620 |
|
notation |
CHEBI:6824 |
|
prefLabel |
Methenamine |
|
smiles |
C1N2CN3CN1CN(C2)C3 |
|
subClassOf |
http://purl.obolibrary.org/obo/CHEBI_33640 |