Preferred Name |
ketoprofen |
|
Synonyms |
2-(3-benzoylphenyl)propanoic acid Ketoprofen Orudis (TN) L'Acide (benzoyl-3-phenyl)-2-propionique 3-Benzoylhydratropic acid 2-(3-Benzoylphenyl)propionic acid 3-Benzoyl-alpha-methylbenzeneacetic acid m-Benzoylhydratropic acid |
|
Definitions |
An oxo monocarboxylic acid that consists of propionic acid substituted by a 3-benzoylphenyl group at position 2. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_6128 |
|
charge |
0 |
|
database_cross_reference |
Drug_Central:1528 KEGG:D00132 PMID:12772856 HMDB:HMDB0015144 Wikipedia:Ketoprofen KEGG:C01716 LINCS:LSM-1955 Reaxys:2216071 DrugBank:DB01009 PMID:11452775 CAS:22071-15-4 PMID:18969772 |
|
definition |
An oxo monocarboxylic acid that consists of propionic acid substituted by a 3-benzoylphenyl group at position 2. |
|
formula |
C16H14O3 |
|
has functional parent | ||
has role |
http://purl.obolibrary.org/obo/CHEBI_35493 http://purl.obolibrary.org/obo/CHEBI_35544 http://purl.obolibrary.org/obo/CHEBI_35703 http://purl.obolibrary.org/obo/CHEBI_35475 |
|
has_exact_synonym |
2-(3-benzoylphenyl)propanoic acid Ketoprofen |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
Orudis (TN) L'Acide (benzoyl-3-phenyl)-2-propionique 3-Benzoylhydratropic acid 2-(3-Benzoylphenyl)propionic acid 3-Benzoyl-alpha-methylbenzeneacetic acid m-Benzoylhydratropic acid |
|
has_RxCUI |
6142 |
|
id |
CHEBI:6128 |
|
in_subset | ||
inchi |
InChI=1S/C16H14O3/c1-11(16(18)19)13-8-5-9-14(10-13)15(17)12-6-3-2-4-7-12/h2-11H,1H3,(H,18,19) |
|
inchikey |
DKYWVDODHFEZIM-UHFFFAOYSA-N |
|
label |
Ketoprofen ketoprofen |
|
mass |
254.28056 |
|
monoisotopicmass |
254.09429 |
|
notation |
CHEBI:6128 |
|
prefLabel |
ketoprofen |
|
smiles |
CC(C(O)=O)c1cccc(c1)C(=O)c1ccccc1 |
|
subClassOf |