Preferred Name |
bromazine |
|
Synonyms |
2-[(4-bromophenyl)(phenyl)methoxy]-N,N-dimethylethanamine beta-(p-bromobenzhydryloxy)ethyldimethylamine 2-(p-bromo-alpha-phenylbenzyloxy)-N,N-dimethylethylamine bromodiphenhydramine beta-dimethylaminoethyl p-bromobenzhydryl ether bromazina bromazine bromazinum |
|
Definitions |
A tertiary amino compound that is the 4-bromobenzhydryl ether of 2-(dimethylamino)ethanol. An antihistamine with antimicrobial properties, it is used in the control of cutaneous allergies. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_59177 |
|
charge |
0 |
|
database_cross_reference |
CAS:118-23-0 Wikipedia:Bromazine DrugBank:DB01237 Drug_Central:404 Reaxys:2057153 Beilstein:2057153 Patent:US2527963 HMDB:HMDB0015367 |
|
definition |
A tertiary amino compound that is the 4-bromobenzhydryl ether of 2-(dimethylamino)ethanol. An antihistamine with antimicrobial properties, it is used in the control of cutaneous allergies. |
|
formula |
C17H20BrNO |
|
has part | ||
has role |
http://purl.obolibrary.org/obo/CHEBI_37955 |
|
has_exact_synonym |
2-[(4-bromophenyl)(phenyl)methoxy]-N,N-dimethylethanamine |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
beta-(p-bromobenzhydryloxy)ethyldimethylamine 2-(p-bromo-alpha-phenylbenzyloxy)-N,N-dimethylethylamine bromodiphenhydramine beta-dimethylaminoethyl p-bromobenzhydryl ether bromazina bromazine bromazinum |
|
has_RxCUI |
19759 |
|
id |
CHEBI:59177 |
|
in_subset | ||
inchi |
InChI=1S/C17H20BrNO/c1-19(2)12-13-20-17(14-6-4-3-5-7-14)15-8-10-16(18)11-9-15/h3-11,17H,12-13H2,1-2H3 |
|
inchikey |
NUNIWXHYABYXKF-UHFFFAOYSA-N |
|
label |
bromodiphenhydramine bromazine |
|
mass |
334.25100 |
|
monoisotopicmass |
333.07283 |
|
notation |
CHEBI:59177 |
|
prefLabel |
bromazine |
|
smiles |
CN(C)CCOC(c1ccccc1)c1ccc(Br)cc1 |
|
subClassOf |