Preferred Name |
Didanosine |
|
Synonyms |
2',3'-dideoxyinosine Didanosine 9-((2S,5R)-5-Hydroxymethyl-tetrahydro-furan-2-yl)-9H-purin-6-ol didanosinum 9-((2R,5S)-5-(hydroxymethyl)-tetrahydrofuran-2-yl)-1H-purin-6(9H)-one 9-((2R,5S)-5-Hydroxymethyl-tetrahydro-furan-2-yl)-1,9-dihydro-purin-6-one dideoxyinosine 9-[(2R,5S)-5-(hydroxymethyl)tetrahydrofuran-2-yl]-1,9-dihydro-6H-purin-6-one 2,3-dideoxyinosine DDI ddI ddIno didanosina didanosine |
|
Definitions |
A purine 2',3'-dideoxyribonucleoside that is inosine in which the hydroxy groups at both the 2' and the 3' positions on the sugar moiety have been replaced by hydrogen. An antiviral drug, it is used as a medication to treat HIV/AIDS. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_490877 |
|
charge |
0 |
|
database_cross_reference |
PDBeChem:2DI Patent:EP206497 PMID:17046264 KEGG:C06953 Drug_Central:869 LINCS:LSM-6017 PMID:7518199 Beilstein:3619529 PMID:10386939 PMID:18549801 Reaxys:3619529 PMID:1619614 DrugBank:DB00900 CAS:69655-05-6 Wikipedia:Didanosine PMID:29438107 Chemspider:45864 KEGG:D00296 |
|
definition |
A purine 2',3'-dideoxyribonucleoside that is inosine in which the hydroxy groups at both the 2' and the 3' positions on the sugar moiety have been replaced by hydrogen. An antiviral drug, it is used as a medication to treat HIV/AIDS. |
|
formula |
C10H12N4O3 |
|
has role |
http://purl.obolibrary.org/obo/CHEBI_53756 http://purl.obolibrary.org/obo/CHEBI_176497 http://purl.obolibrary.org/obo/CHEBI_35221 |
|
has_alternative_id |
CHEBI:158219 CHEBI:39738 CHEBI:668806 CHEBI:475381 CHEBI:4516 |
|
has_exact_synonym |
2',3'-dideoxyinosine Didanosine |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
9-((2S,5R)-5-Hydroxymethyl-tetrahydro-furan-2-yl)-9H-purin-6-ol didanosinum 9-((2R,5S)-5-(hydroxymethyl)-tetrahydrofuran-2-yl)-1H-purin-6(9H)-one 9-((2R,5S)-5-Hydroxymethyl-tetrahydro-furan-2-yl)-1,9-dihydro-purin-6-one dideoxyinosine 9-[(2R,5S)-5-(hydroxymethyl)tetrahydrofuran-2-yl]-1,9-dihydro-6H-purin-6-one 2,3-dideoxyinosine DDI ddI ddIno didanosina didanosine |
|
has_RxCUI |
3364 |
|
id |
CHEBI:490877 |
|
in_subset | ||
inchi |
InChI=1S/C10H12N4O3/c15-3-6-1-2-7(17-6)14-5-13-8-9(14)11-4-12-10(8)16/h4-7,15H,1-3H2,(H,11,12,16)/t6-,7+/m0/s1 |
|
inchikey |
BXZVVICBKDXVGW-NKWVEPMBSA-N |
|
label |
Didanosine didanosine |
|
mass |
236.22730 |
|
monoisotopicmass |
236.09094 |
|
notation |
CHEBI:490877 |
|
prefLabel |
Didanosine |
|
smiles |
OC[C@@H]1CC[C@@H](O1)n1cnc2c1nc[nH]c2=O |
|
subClassOf |