loading...| Preferred Name |
Ethosuximide |
|
| Synonyms |
3-ethyl-3-methylpyrrolidine-2,5-dione Ethosuximide alpha-methyl-alpha-ethylsuccinimide 3-methyl-3-ethylpyrrolidine-2,5-dione 3-ethyl-3-methyl-2,5-pyrrolidinedione ethosuximide 2-ethyl-2-methylsuccinimide etosuximida gamma-methyl-gamma-ethyl-succinimide 3-ethyl-3-methylsuccinimide 3-methyl-3-ethylsuccinimide gamma-ethyl-gamma-methyl-succinimide 2-methyl-2-ethylsuccinimide (+-)-2-ethyl-2-methylsuccinimide alpha-ethyl-alpha-methylsuccinimide ethosuximidum Aethosuximide |
|
| Definitions |
A dicarboximide that is pyrrolidine-2,5-dione in which the hydrogens at position 3 are substituted by one methyl and one ethyl group. An antiepileptic, it is used in the treatment of absence seizures and may be used for myoclonic seizures, but is ineffective against tonic-clonic seizures. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_4887 |
|
| charge |
0 |
|
| database_cross_reference |
PMID:1992141 DrugBank:DB00593 PMID:17011080 PMID:3820228 PMID:21945797 Wikipedia:Ethosuximide Drug_Central:1087 PMID:3336019 PMID:17046248 LINCS:LSM-5195 PMID:17481896 PMID:19005061 PMID:1847429 PMID:8246220 KEGG:C07505 Reaxys:117054 HMDB:HMDB0014731 PMID:1681105 PMID:17451232 PMID:8691481 PMID:16606760 PMID:8627613 PMID:12873507 PMID:21332949 PMID:2061925 Chemspider:3175 PMID:18949032 PMID:2296016 KEGG:D00539 PMID:2308142 PMID:9016327 CAS:77-67-8 |
|
| definition |
A dicarboximide that is pyrrolidine-2,5-dione in which the hydrogens at position 3 are substituted by one methyl and one ethyl group. An antiepileptic, it is used in the treatment of absence seizures and may be used for myoclonic seizures, but is ineffective against tonic-clonic seizures. |
|
| formula |
C7H11NO2 |
|
| has role |
http://purl.obolibrary.org/obo/CHEBI_194338 |
|
| has_alternative_id |
CHEBI:131811 |
|
| has_exact_synonym |
3-ethyl-3-methylpyrrolidine-2,5-dione Ethosuximide |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
alpha-methyl-alpha-ethylsuccinimide 3-methyl-3-ethylpyrrolidine-2,5-dione 3-ethyl-3-methyl-2,5-pyrrolidinedione ethosuximide 2-ethyl-2-methylsuccinimide etosuximida gamma-methyl-gamma-ethyl-succinimide 3-ethyl-3-methylsuccinimide 3-methyl-3-ethylsuccinimide gamma-ethyl-gamma-methyl-succinimide 2-methyl-2-ethylsuccinimide (+-)-2-ethyl-2-methylsuccinimide alpha-ethyl-alpha-methylsuccinimide ethosuximidum Aethosuximide |
|
| has_RxCUI |
4135 |
|
| id |
CHEBI:4887 |
|
| in_subset | ||
| inchi |
InChI=1S/C7H11NO2/c1-3-7(2)4-5(9)8-6(7)10/h3-4H2,1-2H3,(H,8,9,10) |
|
| inchikey |
HAPOVYFOVVWLRS-UHFFFAOYSA-N |
|
| is_bearer_of | ||
| label |
ethosuximide Ethosuximide |
|
| mass |
141.16770 |
|
| monoisotopicmass |
141.07898 |
|
| notation |
CHEBI:4887 |
|
| prefLabel |
Ethosuximide |
|
| smiles |
CCC1(C)CC(=O)NC1=O |
|
| subClassOf |