Preferred Name |
Phenylbutazone |
|
Synonyms |
4-butyl-1,2-diphenylpyrazolidine-3,5-dione Phenylbutazone phenylbutazone 3,5-Dioxo-1,2-diphenyl-4-n-butylpyrazolidine 4-n-Butyl-1,2-diphenyl-3,5-pyrazolidinedione phenylbutazonum Phenbutazone Phenylbutazon fenilbutazona 4-BUTYL-1,2-DIPHENYL-PYRAZOLIDINE-3,5-DIONE |
|
Definitions |
A member of the class of pyrazolidines that is 1,2-diphenylpyrazolidine-3,5-dione carrying a butyl group at the 4-position. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_48574 |
|
charge |
0 |
|
database_cross_reference |
PMID:7655439 PMID:22245664 PMID:19614844 CAS:50-33-9 PMID:23525812 PMID:13747451 PMID:13010905 PMID:20176071 Beilstein:290080 DrugBank:DB00812 Drug_Central:2145 PMID:13048452 PMID:12692637 Reaxys:290080 PMID:26808199 PMID:25287371 PMID:22180948 PMID:3425858 PMID:22082440 LINCS:LSM-2219 Wikipedia:Phenylbutazone KEGG:C07440 HMDB:HMDB0014950 KEGG:D00510 PMID:23369749 PMID:26090772 PDBeChem:P1Z PMID:21668837 PMID:11264893 VSDB:1775 |
|
definition |
A member of the class of pyrazolidines that is 1,2-diphenylpyrazolidine-3,5-dione carrying a butyl group at the 4-position. |
|
formula |
C19H20N2O2 |
|
has role |
http://purl.obolibrary.org/obo/CHEBI_49110 http://purl.obolibrary.org/obo/CHEBI_73136 http://purl.obolibrary.org/obo/CHEBI_35475 |
|
has_alternative_id |
CHEBI:44635 CHEBI:8091 |
|
has_exact_synonym |
4-butyl-1,2-diphenylpyrazolidine-3,5-dione Phenylbutazone |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
phenylbutazone 3,5-Dioxo-1,2-diphenyl-4-n-butylpyrazolidine 4-n-Butyl-1,2-diphenyl-3,5-pyrazolidinedione phenylbutazonum Phenbutazone Phenylbutazon fenilbutazona 4-BUTYL-1,2-DIPHENYL-PYRAZOLIDINE-3,5-DIONE |
|
has_RxCUI |
8160 |
|
id |
CHEBI:48574 |
|
in_subset | ||
inchi |
InChI=1S/C19H20N2O2/c1-2-3-14-17-18(22)20(15-10-6-4-7-11-15)21(19(17)23)16-12-8-5-9-13-16/h4-13,17H,2-3,14H2,1H3 |
|
inchikey |
VYMDGNCVAMGZFE-UHFFFAOYSA-N |
|
label |
phenylbutazone Phenylbutazone |
|
mass |
308.37430 |
|
monoisotopicmass |
308.15248 |
|
notation |
CHEBI:48574 |
|
prefLabel |
Phenylbutazone |
|
smiles |
CCCCC1C(=O)N(N(C1=O)c1ccccc1)c1ccccc1 |
|
subClassOf |