loading...| Preferred Name |
Ergotamine |
|
| Synonyms |
(10alphaH)-5'alpha-benzyl-12'-hydroxy-2'-methyl-3',6',18-trioxo-9,10-dihydroergotaman Dihydroergotamine dihydroergotaminum 9,10-dihydro-12'-hydroxy-2'-methyl-5'-(phenylmethyl)ergotoman-3',6',18-trione dihidroergotamina 9,10-dihydroergotamine 5'-benzyl-12'-hydroxy-2'-methyl-3',6',18-trioxo-9,10-dihydroergotaman dihydroergotamine |
|
| Definitions |
Ergotamine in which a single bond replaces the double bond between positions 9 and 10. A semisynthetic ergot alkaloid with weaker oxytocic and vasoconstrictor properties than ergotamine, it is used (as the methanesulfonic or tartaric acid salts) for the treatment of migraine and orthostatic hypotension. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_4562 |
|
| charge |
0 |
|
| database_cross_reference |
KEGG:C07798 KEGG:D07837 PMID:8145914 Wikipedia:Dihydroergotamine PMID:20132337 LINCS:LSM-3619 PMID:10954953 Beilstein:78887 CAS:511-12-6 KNApSAcK:C00001724 Drug_Central:888 DrugBank:DB00320 |
|
| definition |
Ergotamine in which a single bond replaces the double bond between positions 9 and 10. A semisynthetic ergot alkaloid with weaker oxytocic and vasoconstrictor properties than ergotamine, it is used (as the methanesulfonic or tartaric acid salts) for the treatment of migraine and orthostatic hypotension. |
|
| formula |
C33H37N5O5 |
|
| has role |
http://purl.obolibrary.org/obo/CHEBI_51065 http://purl.obolibrary.org/obo/CHEBI_66991 http://purl.obolibrary.org/obo/CHEBI_35941 |
|
| has_alternative_id |
CHEBI:658566 CHEBI:4826 |
|
| has_exact_synonym |
(10alphaH)-5'alpha-benzyl-12'-hydroxy-2'-methyl-3',6',18-trioxo-9,10-dihydroergotaman Dihydroergotamine |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
dihydroergotaminum 9,10-dihydro-12'-hydroxy-2'-methyl-5'-(phenylmethyl)ergotoman-3',6',18-trione dihidroergotamina 9,10-dihydroergotamine 5'-benzyl-12'-hydroxy-2'-methyl-3',6',18-trioxo-9,10-dihydroergotaman dihydroergotamine |
|
| has_RxCUI |
3418 4025 |
|
| id |
CHEBI:4562 |
|
| in_subset | ||
| inchi |
InChI=1S/C33H37N5O5/c1-32(35-29(39)21-15-23-22-10-6-11-24-28(22)20(17-34-24)16-25(23)36(2)18-21)31(41)38-26(14-19-8-4-3-5-9-19)30(40)37-13-7-12-27(37)33(38,42)43-32/h3-6,8-11,17,21,23,25-27,34,42H,7,12-16,18H2,1-2H3,(H,35,39)/t21-,23-,25-,26+,27+,32-,33+/m1/s1 |
|
| inchikey |
LUZRJRNZXALNLM-JGRZULCMSA-N |
|
| label |
Dihydroergotamine dihydroergotamine Ergotamine |
|
| mass |
583.67740 |
|
| monoisotopicmass |
583.27947 |
|
| notation |
CHEBI:4562 |
|
| prefLabel |
Ergotamine |
|
| smiles |
[H][C@@]12Cc3c[nH]c4cccc(c34)[C@@]1([H])C[C@H](CN2C)C(=O)N[C@]1(C)O[C@]2(O)N([C@@H](Cc3ccccc3)C(=O)N3CCC[C@@]23[H])C1=O |
|
| subClassOf |