loading...| Preferred Name |
diethylpropion |
|
| Synonyms |
Diethylpropion 2-(diethylamino)-1-phenylpropan-1-one anfepramona 2-(diethylamino)propiophenone (+-)-diethylpropion alpha-benzoyltriethylamine Amfepramone alpha-diethylaminopropiophenone 1-phenyl-2-diethylamino-1-propanone 2-(diethylamino)-1-phenyl-1-propanone amfepramone amfepramonum |
|
| Definitions |
An aromatic ketone that is propiophenone in which one of the hydrogens alpha- to the carbonyl is substituted by a diethylamino group. A central stimulant and indirect-acting sympathomimetic, it is an appetite depressant and is used as the hydrochloride as an anoretic in the short term management of obesity. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_4530 |
|
| charge |
0 |
|
| database_cross_reference |
Drug_Central:874 KEGG:C06954 Patent:US3001910 PMID:18976683 Reaxys:2804400 CAS:90-84-6 DrugBank:DB00937 HMDB:HMDB0015072 KEGG:D07444 Beilstein:2804400 Wikipedia:Diethylpropion LINCS:LSM-5038 |
|
| definition |
An aromatic ketone that is propiophenone in which one of the hydrogens alpha- to the carbonyl is substituted by a diethylamino group. A central stimulant and indirect-acting sympathomimetic, it is an appetite depressant and is used as the hydrochloride as an anoretic in the short term management of obesity. |
|
| formula |
C13H19NO |
|
| has functional parent | ||
| has role | ||
| has_exact_synonym |
Diethylpropion 2-(diethylamino)-1-phenylpropan-1-one |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
anfepramona 2-(diethylamino)propiophenone (+-)-diethylpropion alpha-benzoyltriethylamine Amfepramone alpha-diethylaminopropiophenone 1-phenyl-2-diethylamino-1-propanone 2-(diethylamino)-1-phenyl-1-propanone amfepramone amfepramonum |
|
| has_RxCUI |
3389 |
|
| id |
CHEBI:4530 |
|
| in_subset | ||
| inchi |
InChI=1S/C13H19NO/c1-4-14(5-2)11(3)13(15)12-9-7-6-8-10-12/h6-11H,4-5H2,1-3H3 |
|
| inchikey |
XXEPPPIWZFICOJ-UHFFFAOYSA-N |
|
| label |
Diethylpropion diethylpropion |
|
| mass |
205.29610 |
|
| monoisotopicmass |
205.14666 |
|
| notation |
CHEBI:4530 |
|
| prefLabel |
diethylpropion |
|
| smiles |
CCN(CC)C(C)C(=O)c1ccccc1 |
|
| subClassOf |