Preferred Name |
Dextromethorphan |
|
Synonyms |
(4aS,10S,10aS)-6-methoxy-11-methyl-1,3,4,9,10,10a-hexahydro-2H-10,4a-(epiminoethano)phenanthrene 3-methoxy-17-methyl-9alpha,13alpha,14alpha-morphinan D-methorphan (+)-dextromethorphan Balminil DM (9alpha,13alpha,14alpha)-3-methoxy-17-methylmorphinan d-Methorphan destrometerfano dextromethorphan dextromethorphane (+)-3-methoxy-N-methylmorphinan dextromethorphanum dextrometorfano Dextromorphan dextromethorfan Albutussin Antussan BA 2666 BA-2666 Benylin DM Calmylin DXM Delsym Medicon Romilar Tusilan |
|
Definitions |
A 6-methoxy-11-methyl-1,3,4,9,10,10a-hexahydro-2H-10,4a-(epiminoethano)phenanthrene in which the sterocenters at positions 4a, 10 and 10a have S-configuration. It is a prodrug of dextrorphan and used as an antitussive drug for suppressing cough. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_4470 |
|
charge |
0 |
|
database_cross_reference |
Drug_Central:842 KEGG:D03742 PMID:17573115 PMID:8158182 PMID:12711372 PMID:15505150 PMID:7976530 DrugBank:DB00514 PMID:9705419 LINCS:LSM-2726 KEGG:C06947 CAS:125-71-3 PMID:18160193 PMID:18198471 PMID:2660263 Reaxys:88549 PMID:31094746 Wikipedia:Dextromethorphan PMID:24269965 PMID:17461892 PMID:10869398 PMID:17157116 HMDB:HMDB0001920 |
|
definition |
A 6-methoxy-11-methyl-1,3,4,9,10,10a-hexahydro-2H-10,4a-(epiminoethano)phenanthrene in which the sterocenters at positions 4a, 10 and 10a have S-configuration. It is a prodrug of dextrorphan and used as an antitussive drug for suppressing cough. |
|
formula |
C18H25NO |
|
has functional parent | ||
has role |
http://purl.obolibrary.org/obo/CHEBI_35703 http://purl.obolibrary.org/obo/CHEBI_50910 http://purl.obolibrary.org/obo/CHEBI_78298 http://purl.obolibrary.org/obo/CHEBI_60643 http://purl.obolibrary.org/obo/CHEBI_50266 |
|
has_alternative_id |
CHEBI:92579 |
|
has_exact_synonym |
(4aS,10S,10aS)-6-methoxy-11-methyl-1,3,4,9,10,10a-hexahydro-2H-10,4a-(epiminoethano)phenanthrene 3-methoxy-17-methyl-9alpha,13alpha,14alpha-morphinan |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
D-methorphan 3-methoxy-17-methyl-9alpha,13alpha,14alpha-morphinan (+)-dextromethorphan Balminil DM (9alpha,13alpha,14alpha)-3-methoxy-17-methylmorphinan d-Methorphan destrometerfano dextromethorphan dextromethorphane (+)-3-methoxy-N-methylmorphinan dextromethorphanum dextrometorfano Dextromorphan dextromethorfan Albutussin Antussan BA 2666 BA-2666 Benylin DM Calmylin DXM Delsym Medicon Romilar Tusilan |
|
has_RxCUI |
3289 |
|
id |
CHEBI:4470 |
|
in_subset | ||
inchi |
InChI=1S/C18H25NO/c1-19-10-9-18-8-4-3-5-15(18)17(19)11-13-6-7-14(20-2)12-16(13)18/h6-7,12,15,17H,3-5,8-11H2,1-2H3/t15-,17+,18+/m1/s1 |
|
inchikey |
MKXZASYAUGDDCJ-NJAFHUGGSA-N |
|
is enantiomer of | ||
is_bearer_of | ||
label |
dextromethorphan Dextromethorphan |
|
mass |
271.404 |
|
monoisotopicmass |
271.19361 |
|
notation |
CHEBI:4470 |
|
prefLabel |
Dextromethorphan |
|
smiles |
C=1C=2C[C@H]3[C@@]4([C@](C2C=C(C1)OC)(CCCC4)CCN3C)[H] |
|
subClassOf |