loading...| Preferred Name |
(S)-amphetamine |
|
| Synonyms |
(2S)-1-phenylpropan-2-amine (S)-amphetamine d-amphetamine (S)-(+)-beta-phenylisopropylamine (+)-(S)-amphetamine (+)-amphetamine dexamphetamine (S)-alpha-methylbenzeneethanamine (S)-1-phenyl-2-propylamine (+)-alpha-methylphenylethylamine (+)-alpha-methylphenethylamine (S)-(+)-amphetamine (alphaS)-alpha-methylbenzeneethanamine Dextroamphetamine (S)-1-phenyl-2-aminopropane |
|
| Definitions |
A 1-phenylpropan-2-amine that has S configuration. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_4469 |
|
| charge |
0 |
|
| database_cross_reference |
KEGG:D03740 PMID:22894820 PMID:23851485 Drug_Central:841 PMID:23881044 PMID:24349338 CAS:51-64-9 DrugBank:DB01576 PMID:22129527 Wikipedia:Dextroamphetamine KEGG:C07884 Beilstein:2205872 PMID:23907377 Gmelin:1125854 PMID:23360956 |
|
| definition |
A 1-phenylpropan-2-amine that has S configuration. |
|
| formula |
C9H13N |
|
| has role |
http://purl.obolibrary.org/obo/CHEBI_51039 http://purl.obolibrary.org/obo/CHEBI_35524 |
|
| has_exact_synonym |
(2S)-1-phenylpropan-2-amine (S)-amphetamine |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
d-amphetamine (S)-(+)-beta-phenylisopropylamine (+)-(S)-amphetamine (+)-amphetamine dexamphetamine (S)-alpha-methylbenzeneethanamine (S)-1-phenyl-2-propylamine (+)-alpha-methylphenylethylamine (+)-alpha-methylphenethylamine (S)-(+)-amphetamine (alphaS)-alpha-methylbenzeneethanamine Dextroamphetamine (S)-1-phenyl-2-aminopropane |
|
| has_RxCUI |
3288 |
|
| id |
CHEBI:4469 |
|
| in_subset | ||
| inchi |
InChI=1S/C9H13N/c1-8(10)7-9-5-3-2-4-6-9/h2-6,8H,7,10H2,1H3/t8-/m0/s1 |
|
| inchikey |
KWTSXDURSIMDCE-QMMMGPOBSA-N |
|
| is enantiomer of | ||
| label |
(S)-amphetamine Dextroamphetamine |
|
| mass |
135.20626 |
|
| monoisotopicmass |
135.10480 |
|
| notation |
CHEBI:4469 |
|
| prefLabel |
(S)-amphetamine |
|
| smiles |
C[C@H](N)Cc1ccccc1 |
|
| subClassOf |