Preferred Name |
Clemastine |
|
Synonyms |
(2R)-2-{2-[(1R)-1-(4-chlorophenyl)-1-phenylethoxy]ethyl}-1-methylpyrrolidine Clemastine clemastinum (+)-(2R)-2-(2-(((R)-p-chloro-alpha-methyl-alpha-phenylbenzyl)oxy)ethyl)-1-methylpyrrolidine (+)-(2R)-2-[2-[[(R)-p-chloro-alpha-methyl-alpha-phenylbenzyl]oxy]ethyl]-1-methylpyrrolidine clemastina clemastine |
|
Definitions |
2-[(2R)-1-Methylpyrrolidin-2-yl]ethanol in which the hydrogen of the hydroxy group is substituted by a 1-(4-chlorophenyl)-1-phenylethyl group (R configuration). An antihistamine with antimuscarinic and moderate sedative properties, it is used as its fumarate salt for the symptomatic relief of allergic conditions such as rhinitis, urticaria, conjunctivitis and in pruritic (severe itching) skin conditions. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_3738 |
|
charge |
0 |
|
database_cross_reference |
CAS:15686-51-8 LINCS:LSM-2655 DrugBank:DB00283 Drug_Central:671 PMID:18788725 KEGG:C06913 Patent:GB942152 KEGG:D03535 Wikipedia:Clemastine Beilstein:6486432 |
|
definition |
2-[(2R)-1-Methylpyrrolidin-2-yl]ethanol in which the hydrogen of the hydroxy group is substituted by a 1-(4-chlorophenyl)-1-phenylethyl group (R configuration). An antihistamine with antimuscarinic and moderate sedative properties, it is used as its fumarate salt for the symptomatic relief of allergic conditions such as rhinitis, urticaria, conjunctivitis and in pruritic (severe itching) skin conditions. |
|
formula |
C21H26ClNO |
|
has role |
http://purl.obolibrary.org/obo/CHEBI_37955 http://purl.obolibrary.org/obo/CHEBI_48876 |
|
has_alternative_id |
CHEBI:569763 |
|
has_exact_synonym |
(2R)-2-{2-[(1R)-1-(4-chlorophenyl)-1-phenylethoxy]ethyl}-1-methylpyrrolidine Clemastine |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
clemastinum (+)-(2R)-2-(2-(((R)-p-chloro-alpha-methyl-alpha-phenylbenzyl)oxy)ethyl)-1-methylpyrrolidine (+)-(2R)-2-[2-[[(R)-p-chloro-alpha-methyl-alpha-phenylbenzyl]oxy]ethyl]-1-methylpyrrolidine clemastina clemastine |
|
has_RxCUI |
2578 |
|
id |
CHEBI:3738 |
|
in_subset | ||
inchi |
InChI=1S/C21H26ClNO/c1-21(17-7-4-3-5-8-17,18-10-12-19(22)13-11-18)24-16-14-20-9-6-15-23(20)2/h3-5,7-8,10-13,20H,6,9,14-16H2,1-2H3/t20-,21-/m1/s1 |
|
inchikey |
YNNUSGIPVFPVBX-NHCUHLMSSA-N |
|
is_bearer_of | ||
label |
Clemastine clemastine |
|
mass |
343.89000 |
|
monoisotopicmass |
343.17029 |
|
notation |
CHEBI:3738 |
|
prefLabel |
Clemastine |
|
smiles |
[H][C@@]1(CCCN1C)CCO[C@](C)(c1ccccc1)c1ccc(Cl)cc1 |
|
subClassOf |