Preferred Name |
Cimetidine |
|
Synonyms |
2-cyano-1-methyl-3-(2-{[(5-methyl-1H-imidazol-4-yl)methyl]sulfanyl}ethyl)guanidine 2-cyano-1-methyl-3-(2-(((5-methylimidazol-4-yl)methyl)thio)ethyl)guanidine Tagamet HB 200 cimetidinum N-cyano-N'-methyl-N''-(2-([(5-methyl-1H-imidazol-4-yl)methyl]sulfanyl)ethyl)guanidine 1-Cyano-2-methyl-3-(2-(((5-methyl-4-imidazolyl)methyl)thio)ethyl)guanidine N''-cyano-N-methyl-N'-(2-{[(5-methyl-1H-imidazol-4-yl)methyl]thio}ethyl)guanidine Cimetag Ulcerfen cimetidina cimetidine |
|
Definitions |
A member of the class of guanidines that consists of guanidine carrying a methyl substituent at position 1, a cyano group at position 2 and a 2-{[(5-methyl-1H-imidazol-4-yl)methyl]sulfanyl}ethyl group at position 3. It is a H2-receptor antagonist that inhibits the production of acid in stomach. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_3699 |
|
charge |
0 |
|
database_cross_reference |
LINCS:LSM-2404 Wikipedia:Cimetidine HMDB:HMDB0014644 CAS:51481-61-9 PMID:15637527 PMID:7229121 Reaxys:6516325 PMID:11910267 Patent:BE804144 Drug_Central:645 Patent:US3950333 DrugBank:DB00501 KEGG:D00295 VSDB:1892 |
|
definition |
A member of the class of guanidines that consists of guanidine carrying a methyl substituent at position 1, a cyano group at position 2 and a 2-{[(5-methyl-1H-imidazol-4-yl)methyl]sulfanyl}ethyl group at position 3. It is a H2-receptor antagonist that inhibits the production of acid in stomach. |
|
formula |
C10H16N6S |
|
has role |
http://purl.obolibrary.org/obo/CHEBI_50183 http://purl.obolibrary.org/obo/CHEBI_60809 http://purl.obolibrary.org/obo/CHEBI_37961 |
|
has_exact_synonym |
2-cyano-1-methyl-3-(2-{[(5-methyl-1H-imidazol-4-yl)methyl]sulfanyl}ethyl)guanidine |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
2-cyano-1-methyl-3-(2-(((5-methylimidazol-4-yl)methyl)thio)ethyl)guanidine Tagamet HB 200 cimetidinum N-cyano-N'-methyl-N''-(2-([(5-methyl-1H-imidazol-4-yl)methyl]sulfanyl)ethyl)guanidine 1-Cyano-2-methyl-3-(2-(((5-methyl-4-imidazolyl)methyl)thio)ethyl)guanidine N''-cyano-N-methyl-N'-(2-{[(5-methyl-1H-imidazol-4-yl)methyl]thio}ethyl)guanidine Cimetag Ulcerfen cimetidina cimetidine |
|
has_RxCUI |
2541 |
|
id |
CHEBI:3699 |
|
in_subset | ||
inchi |
InChI=1S/C10H16N6S/c1-8-9(16-7-15-8)5-17-4-3-13-10(12-2)14-6-11/h7H,3-5H2,1-2H3,(H,15,16)(H2,12,13,14) |
|
inchikey |
AQIXAKUUQRKLND-UHFFFAOYSA-N |
|
is_bearer_of | ||
label |
Cimetidine cimetidine |
|
mass |
252.34048 |
|
monoisotopicmass |
252.11572 |
|
notation |
CHEBI:3699 |
|
prefLabel |
Cimetidine |
|
smiles |
CN\C(NCCSCc1nc[nH]c1C)=N\C#N |
|
subClassOf |
http://purl.obolibrary.org/obo/CHEBI_22327 http://purl.obolibrary.org/obo/CHEBI_24780 |