Preferred Name |
Cetirizine |
|
Synonyms |
(2-{4-[(4-chlorophenyl)(phenyl)methyl]piperazin-1-yl}ethoxy)acetic acid cetirizinum Cetirizin cetirizina cetirizine |
|
Definitions |
A member of the class of piperazines that is piperazine in which the hydrogens attached to nitrogen are replaced by a (4-chlorophenyl)(phenyl)methyl and a 2-(carboxymethoxy)ethyl group respectively. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_3561 |
|
charge |
0 |
|
database_cross_reference |
Reaxys:7227333 Wikipedia:Cetirizine PMID:20455340 CAS:83881-51-0 KEGG:C07778 PMID:8103703 PMID:15850951 KEGG:D07662 LINCS:LSM-1544 DrugBank:DB00341 HMDB:HMDB0005032 Drug_Central:581 |
|
definition |
A member of the class of piperazines that is piperazine in which the hydrogens attached to nitrogen are replaced by a (4-chlorophenyl)(phenyl)methyl and a 2-(carboxymethoxy)ethyl group respectively. |
|
formula |
C21H25ClN2O3 |
|
has role |
http://purl.obolibrary.org/obo/CHEBI_37955 http://purl.obolibrary.org/obo/CHEBI_35703 |
|
has_exact_synonym |
(2-{4-[(4-chlorophenyl)(phenyl)methyl]piperazin-1-yl}ethoxy)acetic acid |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
cetirizinum Cetirizin cetirizina cetirizine |
|
has_RxCUI |
20610 |
|
id |
CHEBI:3561 |
|
in_subset | ||
inchi |
InChI=1S/C21H25ClN2O3/c22-19-8-6-18(7-9-19)21(17-4-2-1-3-5-17)24-12-10-23(11-13-24)14-15-27-16-20(25)26/h1-9,21H,10-16H2,(H,25,26) |
|
inchikey |
ZKLPARSLTMPFCP-UHFFFAOYSA-N |
|
label |
Cetirizine cetirizine |
|
mass |
388.88800 |
|
monoisotopicmass |
388.15537 |
|
notation |
CHEBI:3561 |
|
prefLabel |
Cetirizine |
|
smiles |
OC(=O)COCCN1CCN(CC1)C(c1ccccc1)c1ccc(Cl)cc1 |
|
subClassOf |
http://purl.obolibrary.org/obo/CHEBI_83403 http://purl.obolibrary.org/obo/CHEBI_25698 |