loading...| Preferred Name |
Permethrin |
|
| Synonyms |
3-phenoxybenzyl 3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropanecarboxylate Permethrin 3-(2,2-Dichloroethenyl)-2,2-dimethylcyclopropane carboxylic acid, (3-phenoxyphenyl) methyl ester (3-Phenoxyphenyl)methyl (+-)-cis,trans-3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropanecarboxylate permethrin |
|
| Definitions |
A cyclopropanecarboxylate ester in which the esterifying alcohol is 3-phenoxybenzyl alcohol and the cyclopropane ring is substituted with a 2,2-dichlorovinyl group and with gem-dimethyl groups. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_34911 |
|
| charge |
0 |
|
| database_cross_reference |
PMID:18692543 PMID:16599165 PMID:21756140 PMID:17980950 PMID:12419701 PMID:14617103 PMID:19079720 Reaxys:5765325 Drug_Central:4152 PMID:21812972 PMID:11082455 PMID:21133424 PMID:21240732 PMID:21235202 Wikipedia:Permethrin PMID:21485369 PMID:16423402 PMID:19835699 PMID:18723882 PMID:17220085 PMID:18274958 PMID:17597311 PMID:15663293 PMID:25042713 CAS:52645-53-1 PMID:17140720 PMID:19343362 PMID:16481707 KEGG:D05443 PMID:20960224 PMID:21809414 PMID:21352824 KEGG:C14388 DrugBank:DB04930 PMID:19278716 PMID:18570364 PMID:21069313 PMID:15599112 PMID:15966049 PMID:19962303 PMID:19090765 PMID:17451859 PMID:21251955 PPDB:515 VSDB:515 |
|
| definition |
A cyclopropanecarboxylate ester in which the esterifying alcohol is 3-phenoxybenzyl alcohol and the cyclopropane ring is substituted with a 2,2-dichlorovinyl group and with gem-dimethyl groups. |
|
| formula |
C21H20Cl2O3 |
|
| has functional parent | ||
| has role |
http://purl.obolibrary.org/obo/CHEBI_39116 http://purl.obolibrary.org/obo/CHEBI_39259 http://purl.obolibrary.org/obo/CHEBI_73333 |
|
| has_exact_synonym |
3-phenoxybenzyl 3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropanecarboxylate Permethrin |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
3-(2,2-Dichloroethenyl)-2,2-dimethylcyclopropane carboxylic acid, (3-phenoxyphenyl) methyl ester (3-Phenoxyphenyl)methyl (+-)-cis,trans-3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropanecarboxylate permethrin |
|
| has_RxCUI |
33199 |
|
| id |
CHEBI:34911 |
|
| in_subset | ||
| inchi |
InChI=1S/C21H20Cl2O3/c1-21(2)17(12-18(22)23)19(21)20(24)25-13-14-7-6-10-16(11-14)26-15-8-4-3-5-9-15/h3-12,17,19H,13H2,1-2H3 |
|
| inchikey |
RLLPVAHGXHCWKJ-UHFFFAOYSA-N |
|
| label |
Permethrin permethrin |
|
| mass |
391.28710 |
|
| monoisotopicmass |
390.07895 |
|
| notation |
CHEBI:34911 |
|
| prefLabel |
Permethrin |
|
| smiles |
CC1(C)C(C=C(Cl)Cl)C1C(=O)OCc1cccc(Oc2ccccc2)c1 |
|
| subClassOf |