loading...| Preferred Name |
cefadroxil |
|
| Synonyms |
7beta-{[(2R)-2-amino-2-(4-hydroxyphenyl)acetyl]amino}-3-methyl-3,4-didehydrocepham-4-carboxylic acid Cefadroxil cefadroxilum D-Cefadroxil Cefadroxil anhydrous Cephadroxil cefadroxilo (6R,7R)-7-{[(2R)-2-amino-2-(4-hydroxyphenyl)acetyl]amino}-3-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid CDX |
|
| Definitions |
A cephalosporin bearing methyl and (2R)-2-amino-2-(4-hydroxyphenyl)acetamido groups at positions 3 and 7, respectively, of the cephem skeleton. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_3479 |
|
| charge |
0 |
|
| database_cross_reference |
LINCS:LSM-5722 CAS:50370-12-2 Patent:US3489752 PMID:9131470 Reaxys:5393893 PMID:12833570 Patent:NL6812382 Patent:DE2216113 DrugBank:DB01140 PMID:23224978 PMID:23959853 Drug_Central:526 PMID:29017833 PMID:24080658 PMID:24412692 KEGG:C06878 Wikipedia:Cefadroxil KEGG:D00257 Patent:US3816253 PMID:24667741 Beilstein:5933893 PMID:21425867 |
|
| definition |
A cephalosporin bearing methyl and (2R)-2-amino-2-(4-hydroxyphenyl)acetamido groups at positions 3 and 7, respectively, of the cephem skeleton. |
|
| formula |
C16H17N3O5S |
|
| has role | ||
| has_exact_synonym |
7beta-{[(2R)-2-amino-2-(4-hydroxyphenyl)acetyl]amino}-3-methyl-3,4-didehydrocepham-4-carboxylic acid Cefadroxil |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
cefadroxilum D-Cefadroxil Cefadroxil anhydrous Cephadroxil cefadroxilo (6R,7R)-7-{[(2R)-2-amino-2-(4-hydroxyphenyl)acetyl]amino}-3-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid CDX |
|
| has_RxCUI |
2177 |
|
| id |
CHEBI:3479 |
|
| in_subset | ||
| inchi |
InChI=1S/C16H17N3O5S/c1-7-6-25-15-11(14(22)19(15)12(7)16(23)24)18-13(21)10(17)8-2-4-9(20)5-3-8/h2-5,10-11,15,20H,6,17H2,1H3,(H,18,21)(H,23,24)/t10-,11-,15-/m1/s1 |
|
| inchikey |
BOEGTKLJZSQCCD-UEKVPHQBSA-N |
|
| is conjugate acid of | ||
| label |
Cefadroxil cefadroxil |
|
| mass |
363.38800 |
|
| monoisotopicmass |
363.08889 |
|
| notation |
CHEBI:3479 |
|
| prefLabel |
cefadroxil |
|
| smiles |
[H][C@]12SCC(C)=C(N1C(=O)[C@H]2NC(=O)[C@H](N)c1ccc(O)cc1)C(O)=O |
|
| subClassOf |