Preferred Name |
carvedilol |
|
Synonyms |
1-(9H-carbazol-4-yloxy)-3-{[2-(2-methoxyphenoxy)ethyl]amino}propan-2-ol Carvedilol carvedilolum (+-)-1-(Carbazol-4-yloxy)-3-((2-(o-methoxyphenoxy)ethyl)amino)-2-propanol SKF 105517 carvedilol |
|
Definitions |
A member of the class of carbazoles that is an adrenergic antagonist with non-selective beta- and alpha-1 receptor blocking properties which helps in the management of congestive heart failure. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_3441 |
|
charge |
0 |
|
database_cross_reference |
Patent:DE2815926 PMID:11389884 Drug_Central:522 PMID:18992766 PMID:17383596 DrugBank:DB01136 Reaxys:1514452 PMID:15184840 Patent:US4503067 CAS:72956-09-3 HMDB:HMDB0015267 KEGG:C06875 KEGG:D00255 Wikipedia:Carvedilol Beilstein:1514452 LINCS:LSM-1310 |
|
definition |
A member of the class of carbazoles that is an adrenergic antagonist with non-selective beta- and alpha-1 receptor blocking properties which helps in the management of congestive heart failure. |
|
formula |
C24H26N2O4 |
|
has role |
http://purl.obolibrary.org/obo/CHEBI_35620 http://purl.obolibrary.org/obo/CHEBI_37890 |
|
has_exact_synonym |
1-(9H-carbazol-4-yloxy)-3-{[2-(2-methoxyphenoxy)ethyl]amino}propan-2-ol Carvedilol |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
carvedilolum (+-)-1-(Carbazol-4-yloxy)-3-((2-(o-methoxyphenoxy)ethyl)amino)-2-propanol SKF 105517 carvedilol |
|
has_RxCUI |
20352 |
|
id |
CHEBI:3441 |
|
in_subset | ||
inchi |
InChI=1S/C24H26N2O4/c1-28-21-10-4-5-11-22(21)29-14-13-25-15-17(27)16-30-23-12-6-9-20-24(23)18-7-2-3-8-19(18)26-20/h2-12,17,25-27H,13-16H2,1H3 |
|
inchikey |
OGHNVEJMJSYVRP-UHFFFAOYSA-N |
|
is_bearer_of | ||
label |
carvedilol |
|
mass |
406.47432 |
|
monoisotopicmass |
406.18926 |
|
notation |
CHEBI:3441 |
|
prefLabel |
carvedilol |
|
smiles |
COc1ccccc1OCCNCC(O)COc1cccc2[nH]c3ccccc3c12 |
|
subClassOf |
http://purl.obolibrary.org/obo/CHEBI_48513 |