Preferred Name |
carbinoxamine |
|
Synonyms |
Carbinoxamine 2-[(4-chlorophenyl)(pyridin-2-yl)methoxy]-N,N-dimethylethanamine {2-[(4-Chloro-phenyl)-pyridin-2-yl-methoxy]-ethyl}-dimethyl-amine carbinoxamine carbinoxamina (+-)-carbinoxamine paracarbinoxamine carbinoxamine base carbinoxaminum 2-(p-chloro-alpha-(2-(dimethylamino)ethoxy)benzyl)pyridine |
|
Definitions |
An organochlorine compound that is 2-(4-chlorobenzyl)pyridine in which one of the benzylic hydrogens is substituted by 2-(dimethylamino)ethoxy group. It is an ethanolamine-type antihistamine, used as its maleate salt for treating hay fever, as well as mild cases of Parkinson's disease. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_3398 |
|
charge |
0 |
|
database_cross_reference |
LINCS:LSM-1435 KEGG:D07617 PMID:6094812 Patent:US2800485 Drug_Central:499 Patent:US2606195 Wikipedia:Carbinoxamine DrugBank:DB00748 Beilstein:250475 KEGG:C06871 HMDB:HMDB0014886 Reaxys:250475 CAS:486-16-8 |
|
definition |
An organochlorine compound that is 2-(4-chlorobenzyl)pyridine in which one of the benzylic hydrogens is substituted by 2-(dimethylamino)ethoxy group. It is an ethanolamine-type antihistamine, used as its maleate salt for treating hay fever, as well as mild cases of Parkinson's disease. |
|
formula |
C16H19ClN2O |
|
has role |
http://purl.obolibrary.org/obo/CHEBI_37955 http://purl.obolibrary.org/obo/CHEBI_48876 |
|
has_alternative_id |
CHEBI:166273 |
|
has_exact_synonym |
Carbinoxamine 2-[(4-chlorophenyl)(pyridin-2-yl)methoxy]-N,N-dimethylethanamine |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
{2-[(4-Chloro-phenyl)-pyridin-2-yl-methoxy]-ethyl}-dimethyl-amine carbinoxamine carbinoxamina (+-)-carbinoxamine paracarbinoxamine carbinoxamine base carbinoxaminum 2-(p-chloro-alpha-(2-(dimethylamino)ethoxy)benzyl)pyridine |
|
has_RxCUI |
20220 |
|
id |
CHEBI:3398 |
|
in_subset | ||
inchi |
InChI=1S/C16H19ClN2O/c1-19(2)11-12-20-16(15-5-3-4-10-18-15)13-6-8-14(17)9-7-13/h3-10,16H,11-12H2,1-2H3 |
|
inchikey |
OJFSXZCBGQGRNV-UHFFFAOYSA-N |
|
label |
carbinoxamine |
|
mass |
290.78800 |
|
monoisotopicmass |
290.11859 |
|
notation |
CHEBI:3398 |
|
prefLabel |
carbinoxamine |
|
smiles |
CN(C)CCOC(c1ccc(Cl)cc1)c1ccccn1 |
|
subClassOf |
http://purl.obolibrary.org/obo/CHEBI_83403 |