loading...| Preferred Name |
Budesonide |
|
| Synonyms |
11beta,21-dihydroxy-16alpha,17alpha-(butane-1,1-diyldioxy)pregna-1,4-diene-3,20-dione (11beta,16alpha)-16,17-(Butylidenebis(oxy))-11,21-dihydroxypregna-1,4-diene-3,20-dione budesonide |
|
| Definitions |
A glucocorticoid steroid having a highly oxygenated pregna-1,4-diene structure. It is used mainly in the treatment of asthma and non-infectious rhinitis and for treatment and prevention of nasal polyposis. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_3207 |
|
| charge |
0 |
|
| database_cross_reference |
CAS:51333-22-3 DrugBank:DB01222 PMID:21616561 KEGG:D00246 Drug_Central:419 Patent:DE2323215 Wikipedia:Budesonide Patent:US3929768 |
|
| definition |
A glucocorticoid steroid having a highly oxygenated pregna-1,4-diene structure. It is used mainly in the treatment of asthma and non-infectious rhinitis and for treatment and prevention of nasal polyposis. |
|
| formula |
C25H34O6 |
|
| has parent hydride | ||
| has role |
http://purl.obolibrary.org/obo/CHEBI_35472 |
|
| has_exact_synonym |
11beta,21-dihydroxy-16alpha,17alpha-(butane-1,1-diyldioxy)pregna-1,4-diene-3,20-dione |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
(11beta,16alpha)-16,17-(Butylidenebis(oxy))-11,21-dihydroxypregna-1,4-diene-3,20-dione budesonide |
|
| has_RxCUI |
19831 |
|
| id |
CHEBI:3207 |
|
| in_subset | ||
| inchi |
InChI=1S/C25H34O6/c1-4-5-21-30-20-11-17-16-7-6-14-10-15(27)8-9-23(14,2)22(16)18(28)12-24(17,3)25(20,31-21)19(29)13-26/h8-10,16-18,20-22,26,28H,4-7,11-13H2,1-3H3/t16-,17-,18-,20+,21?,22+,23-,24-,25+/m0/s1 |
|
| inchikey |
VOVIALXJUBGFJZ-KWVAZRHASA-N |
|
| is_bearer_of | ||
| label |
Budesonide budesonide |
|
| mass |
430.53386 |
|
| monoisotopicmass |
430.23554 |
|
| notation |
CHEBI:3207 |
|
| prefLabel |
Budesonide |
|
| smiles |
[H][C@@]12CCC3=CC(=O)C=C[C@]3(C)[C@@]1([H])[C@@H](O)C[C@@]1(C)[C@@]2([H])C[C@H]2OC(CCC)O[C@@]12C(=O)CO |
|
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_139590 http://purl.obolibrary.org/obo/CHEBI_59770 http://purl.obolibrary.org/obo/CHEBI_36885 http://purl.obolibrary.org/obo/CHEBI_24261 http://purl.obolibrary.org/obo/CHEBI_77166 |