Preferred Name |
glycolate |
|
Synonyms |
hydroxyacetate glycolate |
|
Definitions |
A hydroxy monocarboxylic acid anion that is acetate where the methyl group has been hydroxylated. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_29805 |
|
charge |
-1 |
|
database_cross_reference |
PMID:22446032 KEGG:C00160 PMID:22093610 UM-BBD_compID:c0008 CAS:666-14-8 PMID:22394389 PMID:22268146 DrugBank:DB03085 PMID:22327578 PMID:17190852 PMID:22207577 Reaxys:3903689 MetaCyc:GLYCOLLATE |
|
definition |
A hydroxy monocarboxylic acid anion that is acetate where the methyl group has been hydroxylated. |
|
formula |
C2H3O3 |
|
has functional parent | ||
has role | ||
has_alternative_id |
CHEBI:14348 CHEBI:24388 |
|
has_exact_synonym |
hydroxyacetate glycolate |
|
has_obo_namespace |
chebi_ontology |
|
has_RxCUI |
70603 |
|
id |
CHEBI:29805 |
|
in_subset | ||
inchi |
InChI=1S/C2H4O3/c3-1-2(4)5/h3H,1H2,(H,4,5)/p-1 |
|
inchikey |
AEMRFAOFKBGASW-UHFFFAOYSA-M |
|
is conjugate base of | ||
label |
glycolate |
|
mass |
75.04342 |
|
monoisotopicmass |
75.00877 |
|
notation |
CHEBI:29805 |
|
prefLabel |
glycolate |
|
smiles |
OCC([O-])=O |
|
subClassOf |
Create mapping