loading...| Preferred Name |
Thymol |
|
| Synonyms |
5-methyl-2-(propan-2-yl)phenol Thymol thymol 2-isopropyl-5-methylphenol 1-hydroxy-5-methyl-2-isopropylbenzene 6-isopropyl-m-cresol 5-methyl-2-isopropylphenol 3-p-cymenol 6-isopropyl-3-methylphenol 5-METHYL-2-(1-METHYLETHYL)PHENOL |
|
| Definitions |
A phenol that is a natural monoterpene derivative of cymene. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_27607 |
|
| charge |
0 |
|
| database_cross_reference |
KNApSAcK:C00000155 Drug_Central:4258 PDBeChem:IPB CAS:89-83-8 LIPID_MAPS_instance:LMPR0102090029 DrugBank:DB02513 KEGG:C09908 KEGG:D01039 BPDB:1889 VSDB:1889 |
|
| definition |
A phenol that is a natural monoterpene derivative of cymene. |
|
| formula |
C10H14O |
|
| has parent hydride | ||
| has role | ||
| has_alternative_id |
CHEBI:27006 CHEBI:43365 CHEBI:9581 |
|
| has_exact_synonym |
5-methyl-2-(propan-2-yl)phenol Thymol thymol |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
2-isopropyl-5-methylphenol 1-hydroxy-5-methyl-2-isopropylbenzene 6-isopropyl-m-cresol 5-methyl-2-isopropylphenol 3-p-cymenol 6-isopropyl-3-methylphenol 5-METHYL-2-(1-METHYLETHYL)PHENOL |
|
| has_RxCUI |
10553 |
|
| id |
CHEBI:27607 |
|
| in_subset | ||
| inchi |
InChI=1S/C10H14O/c1-7(2)9-5-4-8(3)6-10(9)11/h4-7,11H,1-3H3 |
|
| inchikey |
MGSRCZKZVOBKFT-UHFFFAOYSA-N |
|
| label |
Thymol thymol |
|
| mass |
150.21756 |
|
| monoisotopicmass |
150.10447 |
|
| notation |
CHEBI:27607 |
|
| prefLabel |
Thymol |
|
| smiles |
CC(C)c1ccc(C)cc1O |
|
| subClassOf |