The Drug Ontology

Last uploaded: October 2, 2019
Preferred Name

amphotericin B liposomal

Synonyms

C47H73NO17

Amphotericine B

AMPH-B

amfotericina B

InChI=1S/C47H73NO17/c1-27-17-15-13-11-9-7-5-6-8-10-12-14-16-18-34(64-46-44(58)41(48)43(57)30(4)63-46)24-38-40(45(59)60)37(54)26-47(61,65-38)25-33(51)22-36(53)35(52)20-19-31(49)21-32(50)23-39(55)62-29(3)28(2)42(27)56/h5-18,27-38,40-44,46,49-54,56-58,61H,19-26,48H2,1-4H3,(H,59,60)/b6-5+,9-7+,10-8+,13-11+,14-12+,17-15+,18-16+/t27-,28-,29-,30+,31+,32+,33-,34-,35+,36+,37-,38-,40+,41-,42+,43+,44-,46-,47+/m0/s1

InChIKey=APKFDSVGJQXUKY-INPOYWNPSA-N

amphotericine B

amphotericinum B

(1R,3S,5R,6R,9R,11R,15S,16R,17R,18S,19E,21E,23E,25E,27E,29E,31E,33R,35S,36R,37S)-33-[(3-amino-3,6-dideoxy-beta-D-mannopyranosyl)oxy]-1,3,5,6,9,11,17,37-octahydroxy-15,16,18-trimethyl-13-oxo-14,39-dioxabicyclo[33.3.1]nonatriaconta-19,21,23,25,27,29,31-heptaene-36-carboxylic acid

amphotericin B

[H][C@]12C[C@@H](O[C@@H]3O[C@H](C)[C@@H](O)[C@H](N)[C@@H]3O)C=C\C=C\C=C\C=C\C=C\C=C\C=C\[C@H](C)[C@@H](O)[C@@H](C)[C@H](C)OC(=O)C[C@H](O)C[C@H](O)CC[C@@H](O)[C@H](O)C[C@H](O)C[C@](O)(C[C@H](O)[C@H]1C(O)=O)O2

Liposomal Amphotericin B

Definitions

A macrolide antibiotic used to treat potentially life-threatening fungal infections.

ID

http://purl.obolibrary.org/obo/CHEBI_2682

database_cross_reference

ChEMBL:1732516

Beilstein:4645978

ChEMBL:566395

Patent:US2908611

ChemIDplus:1397-89-3

KEGG COMPOUND:C06573

Reaxys:4645978

ChEMBL:106303

KEGG DRUG:D00203

LIPID MAPS:LMPK06000002

KEGG DRUG:1397-89-3

KEGG COMPOUND:1397-89-3

DrugBank:DB00681

DrugBank:1397-89-3

ChEMBL:17507115

has_alternative_id

CHEBI:566395

CHEBI:106303

has_exact_synonym

(1R,3S,5R,6R,9R,11R,15S,16R,17R,18S,19E,21E,23E,25E,27E,29E,31E,33R,35S,36R,37S)-33-[(3-amino-3,6-dideoxy-beta-D-mannopyranosyl)oxy]-1,3,5,6,9,11,17,37-octahydroxy-15,16,18-trimethyl-13-oxo-14,39-dioxabicyclo[33.3.1]nonatriaconta-19,21,23,25,27,29,31-heptaene-36-carboxylic acid

has_related_synonym

C47H73NO17

Amphotericine B

AMPH-B

amfotericina B

InChI=1S/C47H73NO17/c1-27-17-15-13-11-9-7-5-6-8-10-12-14-16-18-34(64-46-44(58)41(48)43(57)30(4)63-46)24-38-40(45(59)60)37(54)26-47(61,65-38)25-33(51)22-36(53)35(52)20-19-31(49)21-32(50)23-39(55)62-29(3)28(2)42(27)56/h5-18,27-38,40-44,46,49-54,56-58,61H,19-26,48H2,1-4H3,(H,59,60)/b6-5+,9-7+,10-8+,13-11+,14-12+,17-15+,18-16+/t27-,28-,29-,30+,31+,32+,33-,34-,35+,36+,37-,38-,40+,41-,42+,43+,44-,46-,47+/m0/s1

InChIKey=APKFDSVGJQXUKY-INPOYWNPSA-N

amphotericine B

amphotericinum B

amphotericin B

[H][C@]12C[C@@H](O[C@@H]3O[C@H](C)[C@@H](O)[C@H](N)[C@@H]3O)C=C\C=C\C=C\C=C\C=C\C=C\C=C\[C@H](C)[C@@H](O)[C@@H](C)[C@H](C)OC(=O)C[C@H](O)C[C@H](O)CC[C@@H](O)[C@H](O)C[C@H](O)C[C@](O)(C[C@H](O)[C@H]1C(O)=O)O2

Liposomal Amphotericin B

has_RxCUI

732

236594

id

CHEBI:2682

label

amphotericin B liposomal

Amphotericin B

amphotericin B

notation

CHEBI:2682

prefixIRI

CHEBI:2682

prefLabel

amphotericin B liposomal

textual definition

A macrolide antibiotic used to treat potentially life-threatening fungal infections.

subClassOf

http://purl.obolibrary.org/obo/CHEBI_25105

Delete Subject Author Type Created
No notes to display
Create New Mapping

Delete Mapping To Ontology Source
http://ncicb.nci.nih.gov/xml/owl/EVS/Thesaurus.owl#C1738 NCIT LOOM
http://ncicb.nci.nih.gov/xml/owl/EVS/Thesaurus.owl#C1738 NCIT LOOM
http://purl.obolibrary.org/obo/CHEBI_2682 PHIPO SAME_URI
http://purl.obolibrary.org/obo/CHEBI_2682 PHIPO SAME_URI
http://purl.obolibrary.org/obo/CHEBI_2682 BIOMODELS SAME_URI
http://purl.obolibrary.org/obo/CHEBI_2682 CHEBI SAME_URI
http://purl.obolibrary.org/obo/CHEBI_2682 FYPO SAME_URI
http://purl.obolibrary.org/obo/CHEBI_2682 EUPATH SAME_URI
http://purl.obolibrary.org/obo/CHEBI_2682 CCONT SAME_URI
http://purl.obolibrary.org/obo/CHEBI_2682 EFO SAME_URI
http://purl.obolibrary.org/obo/CHEBI_2682 DINTO SAME_URI
http://purl.obolibrary.org/obo/CHEBI_2682 EFO SAME_URI
http://purl.obolibrary.org/obo/CHEBI_2682 CHEBI SAME_URI
http://purl.obolibrary.org/obo/CHEBI_2682 FYPO SAME_URI
http://purl.obolibrary.org/obo/CHEBI_2682 FYPO SAME_URI
http://purl.obolibrary.org/obo/CHEBI_2682 FYPO SAME_URI
http://purl.obolibrary.org/obo/CHEBI_2682 FYPO SAME_URI
http://purl.bioontology.org/ontology/RXNORM/236594 RXNORM LOOM