Preferred Name |
albuterol |
|
Synonyms |
4-[2-(tert-butylamino)-1-hydroxyethyl]-2-(hydroxymethyl)phenol Albuterol Proventil Salbutamol |
|
Definitions |
A member of the class of phenylethanolamines that is 4-(2-amino-1-hydroxyethyl)-2-(hydroxymethyl)phenol having a tert-butyl group attached to the nirogen atom. It acts as a beta-adrenergic agonist used in the treatment of asthma and chronic obstructive pulmonary disease (COPD). |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_2549 |
|
charge |
0 |
|
database_cross_reference |
KEGG:D02147 Reaxys:2213614 PMID:9847435 CAS:18559-94-9 HMDB:HMDB0001937 PMID:8267204 Wikipedia:Albuterol LINCS:LSM-5178 Drug_Central:105 DrugBank:DB01001 |
|
definition |
A member of the class of phenylethanolamines that is 4-(2-amino-1-hydroxyethyl)-2-(hydroxymethyl)phenol having a tert-butyl group attached to the nirogen atom. It acts as a beta-adrenergic agonist used in the treatment of asthma and chronic obstructive pulmonary disease (COPD). |
|
formula |
C13H21NO3 |
|
has role |
http://purl.obolibrary.org/obo/CHEBI_35703 http://purl.obolibrary.org/obo/CHEBI_35522 |
|
has_exact_synonym |
4-[2-(tert-butylamino)-1-hydroxyethyl]-2-(hydroxymethyl)phenol Albuterol |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
Proventil Salbutamol |
|
has_RxCUI |
435 |
|
id |
CHEBI:2549 |
|
in_subset | ||
inchi |
InChI=1S/C13H21NO3/c1-13(2,3)14-7-12(17)9-4-5-11(16)10(6-9)8-15/h4-6,12,14-17H,7-8H2,1-3H3 |
|
inchikey |
NDAUXUAQIAJITI-UHFFFAOYSA-N |
|
label |
Albuterol albuterol |
|
mass |
239.31070 |
|
monoisotopicmass |
239.15214 |
|
notation |
CHEBI:2549 |
|
prefLabel |
albuterol |
|
smiles |
CC(C)(C)NCC(O)c1ccc(O)c(CO)c1 |
|
subClassOf |
http://purl.obolibrary.org/obo/CHEBI_50995 |