Preferred Name |
Lysine |
|
Synonyms |
2,6-diaminohexanoic acid lysine alpha,epsilon-diaminocaproic acid K LYS Lysin |
|
Definitions |
A diamino acid that is caproic (hexanoic) acid bearing two amino substituents at positions 2 and 6. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_25094 |
|
charge |
0 |
|
database_cross_reference |
Gmelin:279284 Wikipedia:Lysine CAS:70-54-2 KEGG:C16440 PMID:17439666 Reaxys:1616991 Beilstein:1616991 PMID:22264337 |
|
definition |
A diamino acid that is caproic (hexanoic) acid bearing two amino substituents at positions 2 and 6. |
|
formula |
C6H14N2O2 |
|
has functional parent | ||
has part | ||
has role | ||
has_exact_synonym |
2,6-diaminohexanoic acid lysine |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
alpha,epsilon-diaminocaproic acid K LYS Lysin |
|
has_RxCUI |
6536 |
|
id |
CHEBI:25094 |
|
in_subset | ||
inchi |
InChI=1S/C6H14N2O2/c7-4-2-1-3-5(8)6(9)10/h5H,1-4,7-8H2,(H,9,10) |
|
inchikey |
KDXKERNSBIXSRK-UHFFFAOYSA-N |
|
is conjugate acid of | ||
is conjugate base of | ||
label |
Lysine lysine |
|
mass |
146.18764 |
|
monoisotopicmass |
146.10553 |
|
notation |
CHEBI:25094 |
|
prefLabel |
Lysine |
|
smiles |
NCCCCC(N)C(O)=O |
|
subClassOf |
http://purl.obolibrary.org/obo/CHEBI_33704 |
Create mapping