Preferred Name |
Benzoin |
|
Synonyms |
2-hydroxy-1,2-diphenylethanone Benzoin benzoin 2-Hydroxy-2-phenylacetophenone PhCH(OH)COPh Benzoylphenylcarbinol Phenyl-alpha-hydroxybenzyl ketone PhCOCH(OH)Ph Hydroxy-2-phenyl acetophenone 2-Hydroxy-1,2-diphenylethanone alpha-hydroxy-alpha-phenylacetophenone Phenylbenzoyl carbinol alpha-Hydroxy-alpha-phenylacetophenone phenyl-alpha-hydroxybenzyl ketone alpha-Hydroxybenzyl phenyl ketone |
|
Definitions |
A ketone that consists of acetophenone bearing hydroxy and phenyl substituents at the alpha-position. The parent of the class of benzoins. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_17682 |
|
charge |
0 |
|
database_cross_reference |
Beilstein:391839 CAS:119-53-9 PMID:16107154 Reaxys:391839 PMID:17399985 Drug_Central:4663 KEGG:C01408 HMDB:HMDB0032039 PMID:15828829 Wikipedia:Benzoin |
|
definition |
A ketone that consists of acetophenone bearing hydroxy and phenyl substituents at the alpha-position. The parent of the class of benzoins. |
|
formula |
C14H12O2 |
|
has role | ||
has_alternative_id |
CHEBI:22724 CHEBI:13880 CHEBI:3031 |
|
has_exact_synonym |
2-hydroxy-1,2-diphenylethanone Benzoin benzoin |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
2-Hydroxy-2-phenylacetophenone PhCH(OH)COPh Benzoylphenylcarbinol Phenyl-alpha-hydroxybenzyl ketone PhCOCH(OH)Ph Hydroxy-2-phenyl acetophenone 2-Hydroxy-1,2-diphenylethanone alpha-hydroxy-alpha-phenylacetophenone Phenylbenzoyl carbinol alpha-Hydroxy-alpha-phenylacetophenone 2-hydroxy-1,2-diphenylethanone phenyl-alpha-hydroxybenzyl ketone alpha-Hydroxybenzyl phenyl ketone |
|
has_RxCUI |
1406 |
|
id |
CHEBI:17682 |
|
in_subset | ||
inchi |
InChI=1S/C14H12O2/c15-13(11-7-3-1-4-8-11)14(16)12-9-5-2-6-10-12/h1-10,13,15H |
|
inchikey |
ISAOCJYIOMOJEB-UHFFFAOYSA-N |
|
label |
Benzoin benzoin |
|
mass |
212.24388 |
|
monoisotopicmass |
212.08373 |
|
notation |
CHEBI:17682 |
|
prefLabel |
Benzoin |
|
smiles |
OC(C(=O)c1ccccc1)c1ccccc1 |
|
subClassOf |