loading...| Preferred Name |
Carnitine |
|
| Synonyms |
3-hydroxy-4-(trimethylammonio)butanoate carnitine D,L-carnitine |
|
| Definitions |
An amino-acid betaine that is butanoate substituted with a hydroxy group at position C-3 and a trimethylammonium group at C-4. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_17126 |
|
| charge |
0 |
|
| database_cross_reference |
Beilstein:1866665 MetaCyc:DL-CARNITINE Patent:US4315944 Reaxys:1866665 Patent:US4255449 CAS:461-06-3 Wikipedia:Carnitine PMID:23868375 KEGG:C00487 DrugBank:DB02648 PMID:22770225 |
|
| definition |
An amino-acid betaine that is butanoate substituted with a hydroxy group at position C-3 and a trimethylammonium group at C-4. |
|
| formula |
C7H15NO3 |
|
| has functional parent | ||
| has role | ||
| has_alternative_id |
CHEBI:11817 CHEBI:20047 CHEBI:23038 CHEBI:13947 |
|
| has_exact_synonym |
3-hydroxy-4-(trimethylammonio)butanoate carnitine |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
D,L-carnitine |
|
| has_RxCUI |
2106 |
|
| id |
CHEBI:17126 |
|
| in_subset | ||
| inchi |
InChI=1S/C7H15NO3/c1-8(2,3)5-6(9)4-7(10)11/h6,9H,4-5H2,1-3H3 |
|
| inchikey |
PHIQHXFUZVPYII-UHFFFAOYSA-N |
|
| is conjugate base of | ||
| label |
Carnitine carnitine |
|
| mass |
161.19894 |
|
| monoisotopicmass |
161.10519 |
|
| notation |
CHEBI:17126 |
|
| prefLabel |
Carnitine |
|
| smiles |
C[N+](C)(C)CC(O)CC([O-])=O |
|
| subClassOf |