Preferred Name |
anagrelide |
|
Synonyms |
6,7-dichloro-1,5-dihydroimidazo[2,1-]quinazolin-2(3H)-one anagrelidum anagrelida anagrelide |
|
Definitions |
A 1,5-dihydroimidazo[2,1-]quinazoline having an oxo substituent at the 2-position and chloro substituents at the 6- and 7-positions. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_142290 |
|
charge |
0 |
|
database_cross_reference |
Wikipedia:Anagrelide CAS:68475-42-3 Beilstein:619582 DrugBank:DB00261 Drug_Central:209 KEGG:D07455 LINCS:LSM-3380 |
|
definition |
A 1,5-dihydroimidazo[2,1-]quinazoline having an oxo substituent at the 2-position and chloro substituents at the 6- and 7-positions. |
|
formula |
C10H7Cl2N3O |
|
has role |
http://purl.obolibrary.org/obo/CHEBI_50249 http://purl.obolibrary.org/obo/CHEBI_48675 |
|
has_exact_synonym |
6,7-dichloro-1,5-dihydroimidazo[2,1-]quinazolin-2(3H)-one |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
anagrelidum anagrelida anagrelide |
|
has_RxCUI |
596724 |
|
id |
CHEBI:142290 |
|
in_subset | ||
inchi |
InChI=1S/C10H7Cl2N3O/c11-6-1-2-7-5(9(6)12)3-15-4-8(16)14-10(15)13-7/h1-2H,3-4H2,(H,13,14,16) |
|
inchikey |
OTBXOEAOVRKTNQ-UHFFFAOYSA-N |
|
label |
anagrelide |
|
mass |
256.08800 |
|
monoisotopicmass |
254.99662 |
|
notation |
CHEBI:142290 |
|
prefLabel |
anagrelide |
|
smiles |
Clc1ccc2N=C3NC(=O)CN3Cc2c1Cl |
|
subClassOf |