Preferred Name |
zolpidem |
|
Synonyms |
N,N-dimethyl-2-[6-methyl-2-(4-methylphenyl)imidazo[1,2-a]pyridin-3-yl]acetamide N,N,6-Trimethyl-2-(4-methylphenyl)imidazo(1,2-a)pyridine-3-acetamide zolpidem zolpidemum |
|
Definitions |
An imidazo[1,2-a]pyridine compound having a 4-tolyl group at the 2-position, an N,N-dimethylcarbamoylmethyl group at the 3-position and a methyl substituent at the 6-position. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_10125 |
|
charge |
0 |
|
database_cross_reference |
LINCS:LSM-5560 KEGG:C07219 Patent:US4382938 KEGG:D08690 Wikipedia:Zolpidem Drug_Central:2870 DrugBank:DB00425 Beilstein:4355785 Patent:EP50563 CAS:82626-48-0 |
|
definition |
An imidazo[1,2-a]pyridine compound having a 4-tolyl group at the 2-position, an N,N-dimethylcarbamoylmethyl group at the 3-position and a methyl substituent at the 6-position. |
|
formula |
C19H21N3O |
|
has role | ||
has_exact_synonym |
N,N-dimethyl-2-[6-methyl-2-(4-methylphenyl)imidazo[1,2-a]pyridin-3-yl]acetamide |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
N,N,6-Trimethyl-2-(4-methylphenyl)imidazo(1,2-a)pyridine-3-acetamide zolpidem zolpidemum |
|
has_RxCUI |
39993 |
|
id |
CHEBI:10125 |
|
in_subset | ||
inchi |
InChI=1S/C19H21N3O/c1-13-5-8-15(9-6-13)19-16(11-18(23)21(3)4)22-12-14(2)7-10-17(22)20-19/h5-10,12H,11H2,1-4H3 |
|
inchikey |
ZAFYATHCZYHLPB-UHFFFAOYSA-N |
|
label |
zolpidem |
|
mass |
307.38950 |
|
monoisotopicmass |
307.16846 |
|
notation |
CHEBI:10125 |
|
prefLabel |
zolpidem |
|
smiles |
CN(C)C(=O)Cc1c(nc2ccc(C)cn12)-c1ccc(C)cc1 |
|
subClassOf |