Preferred Name |
Norfloxacin |
|
Synonyms |
1-ethyl-6-fluoro-4-oxo-7-(piperazin-1-yl)-1,4-dihydroquinoline-3-carboxylic acid norfloxacine norfloxacino 1-Ethyl-6-fluoro-1,4-dihydro-4-oxo-7-(1-piperazinyl)-3-quinolinecarboxylic acid 1-Ethyl-6-fluor-1,4-dihydro-4-oxo-7-(1-piperazinyl)-3-chinolincarbonsaeure norfloxacin norfloxacinum 1,4-Dihydro-1-ethyl-6-fluoro-4-oxo-7-(1-piperazinyl)-3-quinolinecarboxylic acid NFLX |
|
Definitions |
A quinolinemonocarboxylic acid with broad-spectrum antibacterial activity against most gram-negative and gram-positive bacteria. Norfloxacin is bactericidal and its mode of action depends on blocking of bacterial DNA replication by binding itself to an enzyme called DNA gyrase. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_100246 |
|
charge |
0 |
|
database_cross_reference |
LINCS:LSM-5286 KEGG:D00210 KEGG:C06687 Beilstein:567897 PMID:6461606 Patent:BE863429 DrugBank:DB01059 PMID:3908074 Reaxys:567897 PMID:6234465 PMID:6224685 HMDB:HMDB0015192 Patent:DE2840910 Drug_Central:1967 CAS:70458-96-7 PMID:6211142 Patent:US4146719 Gmelin:1576626 PMID:3317294 Wikipedia:Norfloxacin Patent:US4292317 PMID:6454381 VSDB:1831 |
|
definition |
A quinolinemonocarboxylic acid with broad-spectrum antibacterial activity against most gram-negative and gram-positive bacteria. Norfloxacin is bactericidal and its mode of action depends on blocking of bacterial DNA replication by binding itself to an enzyme called DNA gyrase. |
|
formula |
C16H18FN3O3 |
|
has role |
http://purl.obolibrary.org/obo/CHEBI_59517 http://purl.obolibrary.org/obo/CHEBI_35703 |
|
has_alternative_id |
CHEBI:7629 |
|
has_exact_synonym |
1-ethyl-6-fluoro-4-oxo-7-(piperazin-1-yl)-1,4-dihydroquinoline-3-carboxylic acid |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
norfloxacine norfloxacino 1-Ethyl-6-fluoro-1,4-dihydro-4-oxo-7-(1-piperazinyl)-3-quinolinecarboxylic acid 1-Ethyl-6-fluor-1,4-dihydro-4-oxo-7-(1-piperazinyl)-3-chinolincarbonsaeure norfloxacin norfloxacinum 1,4-Dihydro-1-ethyl-6-fluoro-4-oxo-7-(1-piperazinyl)-3-quinolinecarboxylic acid NFLX |
|
has_RxCUI |
7517 |
|
id |
CHEBI:100246 |
|
in_subset | ||
inchi |
InChI=1S/C16H18FN3O3/c1-2-19-9-11(16(22)23)15(21)10-7-12(17)14(8-13(10)19)20-5-3-18-4-6-20/h7-9,18H,2-6H2,1H3,(H,22,23) |
|
inchikey |
OGJPXUAPXNRGGI-UHFFFAOYSA-N |
|
label |
Norfloxacin norfloxacin |
|
mass |
319.33080 |
|
monoisotopicmass |
319.13322 |
|
notation |
CHEBI:100246 |
|
prefLabel |
Norfloxacin |
|
smiles |
CCn1cc(C(O)=O)c(=O)c2cc(F)c(cc12)N1CCNCC1 |
|
subClassOf |
http://purl.obolibrary.org/obo/CHEBI_87211 http://purl.obolibrary.org/obo/CHEBI_46848 http://purl.obolibrary.org/obo/CHEBI_23765 |