loading...| Preferred Name |
dimercaprol |
|
| Synonyms |
C3H8OS2 2,3-disulfanylpropan-1-ol |
|
| ID |
http://purl.obolibrary.org/obo/dinto_DB06782 |
|
| AHFScode |
64:00.00 |
|
| ATCCode |
V03AB09 |
|
| CASRN |
59-52-9 |
|
| chelates |
http://purl.obolibrary.org/obo/dinto_3069 |
|
| DBBrand |
dimercaprol bal in oil injection |
|
| DBSynonym |
bal british anti-lewisite 2,3-dimercaptopropanol 2,3-dimercapro |
|
| Definition |
Dimercaprol is a traditional chelating agent developed by British biochemists at Oxford University during World War II. It was developed as an experimental antidote against the arsenic-based poison gas Lewisite. It has been used clinically since 1949 in arsenic, cadmium and mercury poisoning. In addition, it has in the past been used for the treatment of Wilson s disease, a genetic disorder in which the body tends to retain copper. Dimercaprol is a potentially toxic drug, and its use may be accompanied by multiple side effects. |
|
| has effect |
http://purl.obolibrary.org/obo/OAE_0000377 http://purl.obolibrary.org/obo/OAE_0000561 http://purl.obolibrary.org/obo/OAE_0000600 http://purl.obolibrary.org/obo/OAE_0000601 http://purl.obolibrary.org/obo/OAE_0000300 http://purl.obolibrary.org/obo/OAE_0000469 http://purl.obolibrary.org/obo/OAE_0000355 http://purl.obolibrary.org/obo/OAE_0000401 |
|
| has pharmacological target |
http://purl.obolibrary.org/obo/dinto_3069 |
|
| InChI |
InChI=1S/C3H8OS2/c4-1-3(6)2-5/h3-6H,1-2H2 |
|
| InChIKey |
InChIKey=WQABCVAJNWAXTE-UHFFFAOYSA-N |
|
| label |
dimercaprol |
|
| prefixIRI |
obo2:dinto_DB06782 |
|
| prefLabel |
dimercaprol |
|
| SMILES |
OCC(S)CS |
|
| Synonym |
C3H8OS2 2,3-disulfanylpropan-1-ol |
|
| xref |
ChEBI:554382 National Drug Code Directory:11098-526-03 PharmGKB:PA165958406 ChemSpider:2971 Wikipedia:http://en.wikipedia.org/wiki/Dimercaprol PubChem Compound:3080 PubChem Substance:99443293 |
|
| subClassOf |