loading...| Preferred Name |
fospropofol |
|
| Synonyms |
C13H21O5P [2,6-bis(propan-2-yl)phenoxymethoxy]phosphonic acid |
|
| ID |
http://purl.obolibrary.org/obo/dinto_DB06716 |
|
| AHFScode |
28:04.92 |
|
| ATCCode |
N01AX10 |
|
| CASRN |
258516-87-9 |
|
| DBBrand |
aquavan lusedra |
|
| DBSalt |
fospropofol disodium |
|
| DBSynonym |
gpi 15715 |
|
| Definition |
Fospropofol is a water soluble prodrug and is converted to propofol in the liver. Fospropofol is a short acting hypnotic/sedative/anesthetic agent. Unlike propofol, does not cause injection-site pain as it is unable to activate TRPA1. FDA approved in December 2008. Fospropofol is classified as a Schedule IV controlled substance in the United States Controlled Substances Act. |
|
| has pharmacological target | ||
| InChI |
InChI=1/C13H21O5P/c1-9(2)11-6-5-7-12(10(3)4)13(11)17-8-18-19(14,15)16/h5-7,9-10H,8H2,1-4H3,(H2,14,15,16) |
|
| InChIKey |
InChIKey=QVNNONOFASOXQV-UHFFFAOYNA-N |
|
| is metabolised by | ||
| is substrate of | ||
| label |
fospropofol |
|
| prefixIRI |
obo2:dinto_DB06716 |
|
| prefLabel |
fospropofol |
|
| related with | ||
| SMILES |
CC(C)C1=CC=CC(C(C)C)=C1OCOP(O)(O)=O |
|
| Synonym |
C13H21O5P [2,6-bis(propan-2-yl)phenoxymethoxy]phosphonic acid |
|
| xref |
RxList:http://www.rxlist.com/lusedra-drug.htm Drugs.com:http://www.drugs.com/ppa/fospropofol.html Wikipedia:http://en.wikipedia.org/wiki/Fospropofol PharmGKB:PA165958389 National Drug Code Directory:62856-350-08 |
|
| subClassOf |