loading...| Preferred Name |
naphazoline |
|
| Synonyms |
2-(naphthalen-1-ylmethyl)-4,5-dihydro-1H-imidazole C14H14N2 |
|
| ID |
http://purl.obolibrary.org/obo/dinto_DB06711 |
|
| activates | ||
| ATCCode |
R01AA08 R01AB02 S01GA01 |
|
| CASRN |
835-31-4 |
|
| DBBrand |
albalon |
|
| DBSalt |
naphazoline hydrochloride |
|
| Definition |
Naphazoline is a rapid acting sympathomimetic vasoconstrictor of occular artierioles. It acts to decrease congestion of the conjunctiva and is found in many over-the-counter eye drops. |
|
| has effect |
http://purl.obolibrary.org/obo/OAE_0000388 http://purl.obolibrary.org/obo/OAE_0000081 http://purl.obolibrary.org/obo/OAE_0000589 http://purl.obolibrary.org/obo/OAE_0000377 http://purl.obolibrary.org/obo/OAE_0001509 http://purl.obolibrary.org/obo/OAE_0000600 |
|
| has pharmacological target | ||
| InChI |
InChI=1S/C14H14N2/c1-2-7-13-11(4-1)5-3-6-12(13)10-14-15-8-9-16-14/h1-7H,8-10H2,(H,15,16) |
|
| InChIKey |
InChIKey=CNIIGCLFLJGOGP-UHFFFAOYSA-N |
|
| label |
naphazoline |
|
| prefixIRI |
obo2:dinto_DB06711 |
|
| prefLabel |
naphazoline |
|
| SMILES |
C(C1=NCCN1)C1=CC=CC2=CC=CC=C12 |
|
| Synonym |
2-(naphthalen-1-ylmethyl)-4,5-dihydro-1H-imidazole C14H14N2 |
|
| xref |
PharmGKB:PA165958384 PubChem Substance:99443263 BindingDB:50027061 Wikipedia:http://en.wikipedia.org/wiki/Naphazoline PubChem Compound:4436 |
|
| subClassOf |