loading...| Preferred Name |
caprylic acid |
|
| Synonyms |
C8H16O2 octanoic acid |
|
| ID |
http://purl.obolibrary.org/obo/dinto_DB04519 |
|
| CASRN |
124-07-2 |
|
| DBSynonym |
caprylsaeure octic acid n-octanoic acid enantic acid n-caprylic acid octoic acid n-octylic acid n-octoic acid neo-fat 8 kaprylsaeure capryloate octylic acid octanoic acid octanoate |
|
| Definition |
Caprylic acid is the common name for the eight-carbon straight chain fatty acid known by the systematic name octanoic acid. It is found naturally in coconuts and breast milk. It is an oily liquid with a slightly unpleasant rancid-like smell that is minimally soluble in water. |
|
| InChI |
InChI=1S/C8H16O2/c1-2-3-4-5-6-7-8(9)10/h2-7H2,1H3,(H,9,10) |
|
| InChIKey |
InChIKey=WWZKQHOCKIZLMA-UHFFFAOYSA-N |
|
| inhibits |
http://purl.obolibrary.org/obo/dinto_1975 |
|
| label |
caprylic acid |
|
| prefixIRI |
obo2:dinto_DB04519 |
|
| prefLabel |
caprylic acid |
|
| related with | ||
| SMILES |
CCCCCCCC(O)=O |
|
| Synonym |
C8H16O2 octanoic acid |
|
| xref |
Wikipedia:http://en.wikipedia.org/wiki/Caprylic_acid PDB:OCA PubChem Substance:46507647 PubChem Compound:379 ChEBI:28837 |
|
| subClassOf |