loading...| Preferred Name |
oleic acid |
|
| Synonyms |
(9E)-octadec-9-enoic acid C18H34O2 |
|
| ID |
http://purl.obolibrary.org/obo/dinto_DB04224 |
|
| CASRN |
112-80-1 |
|
| Definition |
An unsaturated fatty acid that is the most widely distributed and abundant fatty acid in nature. It is used commercially in the preparation of oleates and lotions, and as a pharmaceutical solvent. (Stedman, 26th ed) |
|
| InChI |
InChI=1S/C18H34O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h9-10H,2-8,11-17H2,1H3,(H,19,20)/b10-9+ |
|
| InChIKey |
InChIKey=ZQPPMHVWECSIRJ-MDZDMXLPSA-N |
|
| label |
oleic acid |
|
| prefixIRI |
obo2:dinto_DB04224 |
|
| prefLabel |
oleic acid |
|
| related with |
http://purl.obolibrary.org/obo/dinto_4276 http://purl.obolibrary.org/obo/dinto_0790 http://purl.obolibrary.org/obo/dinto_3740 http://purl.obolibrary.org/obo/dinto_0570 http://purl.obolibrary.org/obo/dinto_4081 http://purl.obolibrary.org/obo/dinto_0645 http://purl.obolibrary.org/obo/dinto_0340 |
|
| SMILES |
CCCCCCCC\C=C\CCCCCCCC(O)=O |
|
| Synonym |
(9E)-octadec-9-enoic acid C18H34O2 |
|
| xref |
PubChem Substance:46506835 PDB:OLA PubChem Compound:637517 ChEBI:16196 |
|
| subClassOf |