loading...| Preferred Name |
palmitic acid |
|
| Synonyms |
hexadecanoic acid C16H32O2 |
|
| ID |
http://purl.obolibrary.org/obo/dinto_DB03796 |
|
| CASRN |
57-10-3 |
|
| DBSynonym |
hexadecylic acid palmitinic acid 1-hexyldecanoic acid 1-pentadecanecarboxylic acid hexadecanoate palmitinsaeure hexadecoic acid hexadecanoic acid fat palmitate hexaectylic acid |
|
| Definition |
A common saturated fatty acid found in fats and waxes including olive oil, palm oil, and body lipids. [PubChem] |
|
| InChI |
InChI=1S/C16H32O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(17)18/h2-15H2,1H3,(H,17,18) |
|
| InChIKey |
InChIKey=IPCSVZSSVZVIGE-UHFFFAOYSA-N |
|
| inhibits | ||
| label |
palmitic acid |
|
| prefixIRI |
obo2:dinto_DB03796 |
|
| prefLabel |
palmitic acid |
|
| related with |
http://purl.obolibrary.org/obo/dinto_0041 http://purl.obolibrary.org/obo/dinto_4235 http://purl.obolibrary.org/obo/dinto_4239 http://purl.obolibrary.org/obo/dinto_4237 http://purl.obolibrary.org/obo/dinto_4233 http://purl.obolibrary.org/obo/dinto_2430 http://purl.obolibrary.org/obo/dinto_2602 http://purl.obolibrary.org/obo/dinto_3740 http://purl.obolibrary.org/obo/dinto_0570 http://purl.obolibrary.org/obo/dinto_0103 http://purl.obolibrary.org/obo/dinto_0340 http://purl.obolibrary.org/obo/dinto_1221 http://purl.obolibrary.org/obo/dinto_2085 http://purl.obolibrary.org/obo/dinto_0523 |
|
| SMILES |
CCCCCCCCCCCCCCCC(O)=O |
|
| Synonym |
hexadecanoic acid C16H32O2 |
|
| xref |
PubChem Substance:46506400 ChEBI:15756 IUPHAR:1055 Guide To Pharmacology:1055 PubChem Compound:985 Wikipedia:http://en.wikipedia.org/wiki/Palmitic_Acid PDB:PLM |
|
| subClassOf |