loading...| Preferred Name |
stearic acid |
|
| Synonyms |
octadecanoic acid C18H36O2 |
|
| ID |
http://purl.obolibrary.org/obo/dinto_DB03193 |
|
| CASRN |
57-11-4 |
|
| DBBrand |
prodhygine hystrene industrene bonderlube 235 dermarone emersol 153nf c-lube 10 flexichem b lunac prifac 2918 |
|
| DBSynonym |
cetylacetic acid n-octadecanoic acidd caswell no. 801d 1-heptadecanecarboxylic acid octadecoic acid stearate octadecansaeure octadecanoic acid fema no. 3035 isostearic acid ola isooctadecanoic acid stearinsaeure fatty acids c16-18 |
|
| Definition |
Stearic acid (IUPAC systematic name: octadecanoic acid) is one of the useful types of saturated fatty acids that comes from many animal and vegetable fats and oils. It is a waxy solid. [Wikipedia] |
|
| InChI |
InChI=1S/C18H36O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h2-17H2,1H3,(H,19,20) |
|
| InChIKey |
InChIKey=QIQXTHQIDYTFRH-UHFFFAOYSA-N |
|
| label |
stearic acid |
|
| prefixIRI |
obo2:dinto_DB03193 |
|
| prefLabel |
stearic acid |
|
| related with |
http://purl.obolibrary.org/obo/dinto_4316 |
|
| SMILES |
CCCCCCCCCCCCCCCCCC(O)=O |
|
| Synonym |
octadecanoic acid C18H36O2 |
|
| xref |
PubChem Substance:46508522 ChEBI:28842 PubChem Compound:5281 Wikipedia:http://en.wikipedia.org/wiki/Stearic_acid PDB:STE |
|
| subClassOf |