loading...| Preferred Name |
acetic acid |
|
| Synonyms |
acetate C2H3O2 |
|
| ID |
http://purl.obolibrary.org/obo/dinto_DB03166 |
|
| ATCCode |
G01AD02 S02AA10 |
|
| CASRN |
64-19-7 |
|
| DBBrand |
volsol borofair acetasol |
|
| DBSynonym |
ethanoat ethanoate |
|
| Definition |
Acetic acid is a product of the oxidation of ethanol and of the destructive distillation of wood. It is used locally, occasionally internally, as a counterirritant and also as a reagent. (Stedman, 26th ed) Acetic acid otic (for the ear) is an antibiotic that treats infections caused by bacteria or fungus. |
|
| has effect | ||
| InChI |
InChI=1S/C2H4O2/c1-2(3)4/h1H3,(H,3,4)/p-1 |
|
| InChIKey |
InChIKey=QTBSBXVTEAMEQO-UHFFFAOYSA-M |
|
| inhibits | ||
| is transported by | ||
| label |
acetic acid |
|
| prefixIRI |
obo2:dinto_DB03166 |
|
| prefLabel |
acetic acid |
|
| SMILES |
CC([O-])=O |
|
| Synonym |
acetate C2H3O2 |
|
| xref |
ChEBI:30089 Drugs.com:http://www.drugs.com/cdi/acetic-acid-solution.html PDB:ACY Wikipedia:http://en.wikipedia.org/wiki/Acetic_acid Guide To Pharmacology:1058 PharmGKB:PA448021 IUPHAR:1058 National Drug Code Directory:0264-2304-00 |
|
| subClassOf |