loading...| Preferred Name |
resveratrol |
|
| Synonyms |
C14H12O3 5-[(E)-2-(4-hydroxyphenyl)ethenyl]benzene-1,3-diol |
|
| ID |
http://purl.obolibrary.org/obo/dinto_DB02709 |
|
| CASRN |
501-36-0 |
|
| DBSynonym |
(e)-5-(2-(4-hydroxyphenyl)ethenyl)-1,3-benzenediol trans-3,4',5-trihydroxystilbene (e)-resveratrol (e)-5-[2-(4-hydroxyphenyl)ethenyl]-1,3-benzenediol 3,4',5-trihydroxystilbene 3,4',5-trihydroxy-stilbene (e)-5-(p-hydroxystyryl)resorcinol (e)-5-[2-(4-hydroxyphenyl)ethenyl]-1,3-benzendiol 3,4',5-stilbenetriol |
|
| Definition |
Resveratrol (3,5,4 -trihydroxystilbene) is a polyphenolic phytoalexin. It is a stilbenoid, a derivate of stilbene, and is produced in plants with the help of the enzyme stilbene synthase. It exists as two structural isomers: cis-(Z) and trans-(E), with the trans-isomer shown in the top image. The trans- form can undergo isomerisation to the cis- form when heated or exposed to ultraviolet irradiation. In a 2004 issue of Science, Dr. Sinclair of Harvard University said resveratrol is not an easy molecule to protect from oxidation. It has been claimed that it is readily degraded by exposure to light, heat, and oxygen. However, studies find that Trans-resveratrol undergoes negligible oxidation in normal atmosphere at room temperature. [Wikipedia] |
|
| InChI |
InChI=1S/C14H12O3/c15-12-5-3-10(4-6-12)1-2-11-7-13(16)9-14(17)8-11/h1-9,15-17H/b2-1+ |
|
| InChIKey |
InChIKey=LUKBXSAWLPMMSZ-OWOJBTEDSA-N |
|
| induces | ||
| inhibits |
http://purl.obolibrary.org/obo/dinto_2651 http://purl.obolibrary.org/obo/dinto_0269 http://purl.obolibrary.org/obo/dinto_0901 http://purl.obolibrary.org/obo/dinto_0285 |
|
| is metabolised by | ||
| label |
resveratrol |
|
| prefixIRI |
obo2:dinto_DB02709 |
|
| prefLabel |
resveratrol |
|
| related with |
http://purl.obolibrary.org/obo/dinto_1573 |
|
| SMILES |
OC1=CC=C(\C=C\C2=CC(O)=CC(O)=C2)C=C1 |
|
| Synonym |
C14H12O3 5-[(E)-2-(4-hydroxyphenyl)ethenyl]benzene-1,3-diol |
|
| xref |
PDB:STL PharmGKB:PA165291843 PubChem Compound:445154 PubChem Substance:46504705 ChemSpider:4880 ChEBI:27881 BindingDB:23926 Wikipedia:http://en.wikipedia.org/wiki/Resveratrol |
|
| subClassOf |