Preferred Name |
dehydroepiandrosterone |
|
Synonyms |
C19H28O2 (1S,2R,5S,10R,11S,15S)-5-hydroxy-2,15-dimethyltetracyclo[8.7.0.0^{2,7}.0^{11,15}]heptadec-7-en-14-one |
|
ID |
http://purl.obolibrary.org/obo/dinto_DB01708 |
|
ATCCode |
A14AA07 |
|
CASRN |
53-43-0 |
|
DBBrand |
fidelin ovigyn-d |
|
DBSynonym |
dhea 5-dhea 3-beta-hydroxy-5-androsten-17-one 5-dehydroepiandrosterone dha prasterone |
|
Definition |
Dehydroepiandrosterone (DHEA) is a major C19 steroid produced by the adrenal cortex. It is also produced in small quantities in the testis and the ovary. Dehydroepiandrosterone (DHEA) can be converted to testosterone; androstenedione; estradiol; and estrone. Most of DHEA is sulfated (dehydroepiandrosterone sulfate) before secretion. In the United States, DHEA or DHEAS have been advertised with claims that they may be beneficial for a wide variety of ailments. DHEA and DHEAS are readily available in the United States, where they are marketed as over-the-counter dietary supplements. In Canada, a prescription is required to buy DHEA. |
|
InChI |
InChI=1S/C19H28O2/c1-18-9-7-13(20)11-12(18)3-4-14-15-5-6-17(21)19(15,2)10-8-16(14)18/h3,13-16,20H,4-11H2,1-2H3/t13-,14-,15-,16-,18-,19-/m0/s1 |
|
InChIKey |
InChIKey=FMGSKLZLMKYGDP-USOAJAOKSA-N |
|
inhibits | ||
is metabolised by | ||
label |
dehydroepiandrosterone |
|
prefixIRI |
obo2:dinto_DB01708 |
|
prefLabel |
dehydroepiandrosterone |
|
related with |
http://purl.obolibrary.org/obo/dinto_1662 http://purl.obolibrary.org/obo/dinto_4257 http://purl.obolibrary.org/obo/dinto_0806 |
|
SMILES |
[H][C@@]12CCC(=O)[C@@]1(C)CC[C@@]1([H])[C@@]2([H])CC=C2C[C@@]([H])(O)CC[C@]12C |
|
Synonym |
C19H28O2 (1S,2R,5S,10R,11S,15S)-5-hydroxy-2,15-dimethyltetracyclo[8.7.0.0^{2,7}.0^{11,15}]heptadec-7-en-14-one |
|
xref |
ChemSpider:5670 ChEBI:28689 PharmGKB:PA451993 IUPHAR:2370 Guide To Pharmacology:2370 Wikipedia:http://en.wikipedia.org/wiki/Dehydroepiandrosterone PubChem Compound:5881 PDB:AND PubChem Substance:46508824 |
|
subClassOf |