loading...| Preferred Name |
flunitrazepam |
|
| Synonyms |
5-(2-fluorophenyl)-1-methyl-7-nitro-2,3-dihydro-1H-1,4-benzodiazepin-2-one C16H12FN3O3 |
|
| ID |
http://purl.obolibrary.org/obo/dinto_DB01544 |
|
| activates | ||
| ATCCode |
N05CD03 |
|
| CASRN |
1622-62-4 |
|
| DBBrand |
roipnol narcozep rohypnol primun |
|
| DBSynonym |
flunitrazepamum [inn-latin] |
|
| Definition |
A benzodiazepine with pharmacologic actions similar to those of diazepam that can cause anterograde amnesia. Some reports indicate that it is used as a date rape drug and suggest that it may precipitate violent behavior. The United States Government has banned the importation of this drug. [PubChem] |
|
| has pharmacological target |
http://purl.obolibrary.org/obo/dinto_0016 http://purl.obolibrary.org/obo/dinto_0630 http://purl.obolibrary.org/obo/dinto_2745 http://purl.obolibrary.org/obo/dinto_2778 |
|
| InChI |
InChI=1S/C16H12FN3O3/c1-19-14-7-6-10(20(22)23)8-12(14)16(18-9-15(19)21)11-4-2-3-5-13(11)17/h2-8H,9H2,1H3 |
|
| InChIKey |
InChIKey=PPTYJKAXVCCBDU-UHFFFAOYSA-N |
|
| inhibits |
http://purl.obolibrary.org/obo/dinto_1890 http://purl.obolibrary.org/obo/dinto_1892 |
|
| is metabolised by |
http://purl.obolibrary.org/obo/dinto_2651 http://purl.obolibrary.org/obo/dinto_2058 http://purl.obolibrary.org/obo/dinto_0291 http://purl.obolibrary.org/obo/dinto_0901 |
|
| label |
flunitrazepam |
|
| may interact with | ||
| prefixIRI |
obo2:dinto_DB01544 |
|
| prefLabel |
flunitrazepam |
|
| related with |
http://purl.obolibrary.org/obo/dinto_0630 http://purl.obolibrary.org/obo/dinto_2778 |
|
| SMILES |
CN1C2=C(C=C(C=C2)[N+]([O-])=O)C(=NCC1=O)C1=CC=CC=C1F |
|
| Synonym |
5-(2-fluorophenyl)-1-methyl-7-nitro-2,3-dihydro-1H-1,4-benzodiazepin-2-one C16H12FN3O3 |
|
| xref |
PubChem Substance:46504553 PharmGKB:PA164781320 PubChem Compound:3380 Wikipedia:http://en.wikipedia.org/wiki/Flunitrazepam ChemSpider:3263 BindingDB:25878 |
|
| subClassOf |