loading...| Preferred Name |
quinethazone |
|
| Synonyms |
C10H12ClN3O3S 7-chloro-2-ethyl-4-oxo-1,2,3,4-tetrahydroquinazoline-6-sulfonamide |
|
| ID |
http://purl.obolibrary.org/obo/dinto_DB01325 |
|
| ATCCode |
C03BA02 |
|
| CASRN |
73-49-4 |
|
| DBBrand |
hydromox aquamox idrokin |
|
| DBSynonym |
quinetazona [inn-spanish] chinethazonum quinethazon chinetazone [dcit] quinethazonum [inn-latin] |
|
| Definition |
Quinethazone (INN, brand name Hydromox) is a thiazide diuretic used to treat hypertension. Common side effects include dizziness, dry mouth, nausea, and low potassium levels. |
|
| has pharmacological target |
http://purl.obolibrary.org/obo/dinto_0757 http://purl.obolibrary.org/obo/dinto_1621 http://purl.obolibrary.org/obo/dinto_1147 |
|
| InChI |
InChI=1S/C10H12ClN3O3S/c1-2-9-13-7-4-6(11)8(18(12,16)17)3-5(7)10(15)14-9/h3-4,9,13H,2H2,1H3,(H,14,15)(H2,12,16,17) |
|
| InChIKey |
InChIKey=AGMMTXLNIQSRCG-UHFFFAOYSA-N |
|
| inhibits |
http://purl.obolibrary.org/obo/dinto_0757 http://purl.obolibrary.org/obo/dinto_1621 http://purl.obolibrary.org/obo/dinto_1147 |
|
| label |
quinethazone |
|
| may interact with | ||
| prefixIRI |
obo2:dinto_DB01325 |
|
| prefLabel |
quinethazone |
|
| SMILES |
CCC1NC(=O)C2=CC(=C(Cl)C=C2N1)S(N)(=O)=O |
|
| Synonym |
C10H12ClN3O3S 7-chloro-2-ethyl-4-oxo-1,2,3,4-tetrahydroquinazoline-6-sulfonamide |
|
| xref |
PharmGKB:PA164760863 ChemSpider:6068 Wikipedia:http://en.wikipedia.org/wiki/Quinethazone PubChem Substance:46507280 BindingDB:25898 PubChem Compound:6307 |
|
| subClassOf |