loading...| Preferred Name |
econazole |
|
| Synonyms |
1-{2-[(4-chlorophenyl)methoxy]-2-(2,4-dichlorophenyl)ethyl}-1H-imidazole C18H15Cl3N2O |
|
| ID |
http://purl.obolibrary.org/obo/dinto_DB01127 |
|
| AHFScode |
84:04.08.08 |
|
| ATCCode |
D01AC03 G01AF05 |
|
| blocks | ||
| CASRN |
27220-47-9 |
|
| DBBrand |
palavale spectazole cream ifenec pevaryl ecostatin cream gyno-pevaryl 150 ecostatin vaginal ovules gyno-pevaryl econazole nitrate spectazole ecostatin |
|
| Definition |
A broad spectrum antimycotic with some action against Gram positive bacteria. It is used topically in dermatomycoses also orally and parenterally. [PubChem] |
|
| has effect |
http://purl.obolibrary.org/obo/OAE_0000373 |
|
| has pharmacological target | ||
| InChI |
InChI=1S/C18H15Cl3N2O/c19-14-3-1-13(2-4-14)11-24-18(10-23-8-7-22-12-23)16-6-5-15(20)9-17(16)21/h1-9,12,18H,10-11H2 |
|
| InChIKey |
InChIKey=LEZWWPYKPKIXLL-UHFFFAOYSA-N |
|
| inhibits |
http://purl.obolibrary.org/obo/dinto_3102 |
|
| label |
econazole |
|
| prefixIRI |
obo2:dinto_DB01127 |
|
| prefLabel |
econazole |
|
| SMILES |
ClC1=CC=C(COC(CN2C=CN=C2)C2=C(Cl)C=C(Cl)C=C2)C=C1 |
|
| Synonym |
1-{2-[(4-chlorophenyl)methoxy]-2-(2,4-dichlorophenyl)ethyl}-1H-imidazole C18H15Cl3N2O |
|
| xref |
Guide To Pharmacology:2446 IUPHAR:2446 PDRhealth:http://www.pdrhealth.com/drug_info/rxdrugprofiles/drugs/spe1410.shtml RxList:http://www.rxlist.com/cgi/generic3/econazole.htm PubChem Compound:3198 Drugs Product Database (DPD):2011948 Wikipedia:http://en.wikipedia.org/wiki/Econazole Drugs.com:http://www.drugs.com/cdi/econazole-cream.html National Drug Code Directory:0168-0312-15 ChemSpider:3086 PharmGKB:PA164746010 PubChem Substance:46508881 ChEBI:4754 |
|
| subClassOf |