loading...| Preferred Name |
testolactone |
|
| Synonyms |
C19H24O3 (1R,2S,7S,10S,11R)-7,11-dimethyl-6-oxatetracyclo[8.8.0.0^{2,7}.0^{11,16}]octadeca-12,15-diene-5,14-dione |
|
| ID |
http://purl.obolibrary.org/obo/dinto_DB00894 |
|
| CASRN |
968-93-4 |
|
| DBBrand |
teolit testolacton teslak teslac fludestrin |
|
| DBSynonym |
testolactona [inn-spanish] testolattone [dcit] testolactonum [inn-latin] |
|
| Definition |
An antineoplastic agent that is a derivative of progesterone and used to treat advanced breast cancer. [PubChem] |
|
| has pharmacological target | ||
| InChI |
InChI=1S/C19H24O3/c1-18-9-7-13(20)11-12(18)3-4-14-15(18)8-10-19(2)16(14)5-6-17(21)22-19/h7,9,11,14-16H,3-6,8,10H2,1-2H3/t14-,15+,16+,18+,19+/m1/s1 |
|
| InChIKey |
InChIKey=BPEWUONYVDABNZ-DZBHQSCQSA-N |
|
| inhibits | ||
| label |
testolactone |
|
| may interact with |
http://purl.obolibrary.org/obo/CHEBI_4031 |
|
| prefixIRI |
obo2:dinto_DB00894 |
|
| prefLabel |
testolactone |
|
| SMILES |
[H][C@@]12CCC3=CC(=O)C=C[C@]3(C)[C@@]1([H])CC[C@]1(C)OC(=O)CC[C@@]21[H] |
|
| Synonym |
C19H24O3 (1R,2S,7S,10S,11R)-7,11-dimethyl-6-oxatetracyclo[8.8.0.0^{2,7}.0^{11,16}]octadeca-12,15-diene-5,14-dione |
|
| xref |
ChEBI:9460 RxList:http://www.rxlist.com/cgi/generic2/testolactone.htm PubChem Compound:13769 PubChem Substance:46508076 Drugs.com:http://www.drugs.com/cdi/testolactone.html National Drug Code Directory:0003-0690-50 PharmGKB:PA164743056 ChemSpider:13172 |
|
| subClassOf |