loading...| Preferred Name |
dienestrol |
|
| Synonyms |
4-[4-(4-hydroxyphenyl)hexa-2,4-dien-3-yl]phenol C18H18O2 |
|
| ID |
http://purl.obolibrary.org/obo/dinto_DB00890 |
|
| activates | ||
| ATCCode |
G03CB01 G03CC02 |
|
| CASRN |
84-17-3 |
|
| DBBrand |
estrodienol estragard agaldog dienol oestroral retalon synestrol estraguard para-dien oestrodiene restrol willnestrol sexadien dinovex follormon oestrodienol dv oestrovis teserene isodienestrol oestrasid hormofemin dienoestrol bp cycladiene estroral dinestrol gynefollin |
|
| DBSynonym |
dehydrostilboestrol dienesterol dienoestrol dehydrostilbestrol |
|
| Definition |
Dienestrol is a synthetic, non-steroidal estrogen. It is an estrogen receptor agonist. Estrogens work partly by increasing a normal clear discharge from the vagina and making the vulva and urethra healthy. Using or applying an estrogen relieves or lessens: dryness and soreness in the vagina, itching, redness, or soreness of the vulva. Conditions that are treated with vaginal estrogens include a genital skin condition (vulvar atrophy), inflammation of the vagina (atrophic vaginitis), and inflammation of the urethra (atrophic urethritis). |
|
| has pharmacological target | ||
| InChI |
InChI=1S/C18H18O2/c1-3-17(13-5-9-15(19)10-6-13)18(4-2)14-7-11-16(20)12-8-14/h3-12,19-20H,1-2H3/b17-3+,18-4+ |
|
| InChIKey |
InChIKey=NFDFQCUYFHCNBW-SCGPFSFSSA-N |
|
| label |
dienestrol |
|
| prefixIRI |
obo2:dinto_DB00890 |
|
| prefLabel |
dienestrol |
|
| SMILES |
CC=C(C(=CC)C1=CC=C(O)C=C1)C1=CC=C(O)C=C1 |
|
| Synonym |
4-[4-(4-hydroxyphenyl)hexa-2,4-dien-3-yl]phenol C18H18O2 |
|
| xref |
RxList:http://www.rxlist.com/cgi/generic2/diene.htm PharmGKB:PA164745534 Wikipedia:http://en.wikipedia.org/wiki/Dienestrol Drugs Product Database (DPD):441295 ChEBI:4518 |
|
| subClassOf |