loading...| Preferred Name |
levamisole |
|
| Synonyms |
C11H12N2S (6S)-6-phenyl-2H,3H,5H,6H-imidazo[2,1-b][1,3]thiazole |
|
| ID |
http://purl.obolibrary.org/obo/dinto_DB00848 |
|
| activates | ||
| ATCCode |
P02CE01 |
|
| CASRN |
14769-73-4 |
|
| DBBrand |
wormicid nilverm base lepuron tetramisole ketrax tramisol tetramisol vermisol 150 ergamisol |
|
| DBSynonym |
phenyl imidothiazole levamisolum [inn-latin] levamisole hydrochloride dl-tetramisole l-tetramisole levamisol [inn-spanish] dl-tetramisol |
|
| Definition |
An antihelminthic drug that has been tried experimentally in rheumatic disorders where it apparently restores the immune response by increasing macrophage chemotaxis and T-lymphocyte function. Paradoxically, this immune enhancement appears to be beneficial in rheumatoid arthritis where dermatitis, leukopenia, and thrombocytopenia, and nausea and vomiting have been reported as side effects. (From Smith and Reynard, Textbook of Pharmacology, 1991, p435-6) |
|
| has pharmacological target | ||
| InChI |
InChI=1S/C11H12N2S/c1-2-4-9(5-3-1)10-8-13-6-7-14-11(13)12-10/h1-5,10H,6-8H2/t10-/m1/s1 |
|
| InChIKey |
InChIKey=HLFSDGLLUJUHTE-SNVBAGLBSA-N |
|
| inhibits | ||
| label |
levamisole |
|
| may interact with |
http://purl.obolibrary.org/obo/CHEBI_53766 http://purl.obolibrary.org/obo/CHEBI_133809 |
|
| prefixIRI |
obo2:dinto_DB00848 |
|
| prefLabel |
levamisole |
|
| SMILES |
C1CN2C[C@@H](N=C2S1)C1=CC=CC=C1 |
|
| Synonym |
C11H12N2S (6S)-6-phenyl-2H,3H,5H,6H-imidazo[2,1-b][1,3]thiazole |
|
| xref |
ChemSpider:25037 Drugs Product Database (DPD):645699 PubChem Substance:46509052 Wikipedia:http://en.wikipedia.org/wiki/Levamisole RxList:http://www.rxlist.com/cgi/generic3/levamisole.htm PharmGKB:PA450205 BindingDB:50241179 Drugs.com:http://www.drugs.com/mtm/levamisole.html PubChem Compound:26879 |
|
| subClassOf |