Preferred Name |
haloprogin |
|
Synonyms |
1,2,4-trichloro-5-[(3-iodoprop-2-yn-1-yl)oxy]benzene C9H4Cl3IO |
|
ID |
http://purl.obolibrary.org/obo/dinto_DB00793 |
|
ATCCode |
D01AE11 |
|
CASRN |
777-11-7 |
|
DBBrand |
haloprogin [usan:inn:jan] mycanden haloprogina [inn-spanish] haloproginum [inn-latin] haloprogine [inn-french] polik aloprogen mycilan halotex |
|
Definition |
Haloprogin is used as a topical ointment or cream in the treatment of Tinea infections. Tinea infections are superficial fungal infections caused by three species of fungi collectively known as dermatophytes (Trichophyton, Microsporum and Epidermophyton). Commonly these infections are named for the body part affected, including tinea corporis (general skin), tinea cruris (groin), and tinea pedis (feet). Haloprogin is a halogenated phenolic ether administered topically for dermotaphytic infections. The mechanism of action is unknown, but it is thought to be via inhibition of oxygen uptake and disruption of yeast membrane structure and function. |
|
InChI |
InChI=1S/C9H4Cl3IO/c10-6-4-8(12)9(5-7(6)11)14-3-1-2-13/h4-5H,3H2 |
|
InChIKey |
InChIKey=CTETYYAZBPJBHE-UHFFFAOYSA-N |
|
label |
haloprogin |
|
prefixIRI |
obo2:dinto_DB00793 |
|
prefLabel |
haloprogin |
|
SMILES |
ClC1=CC(Cl)=C(Cl)C=C1OCC#CI |
|
Synonym |
1,2,4-trichloro-5-[(3-iodoprop-2-yn-1-yl)oxy]benzene C9H4Cl3IO |
|
xref |
Wikipedia:http://en.wikipedia.org/wiki/Haloprogin PubChem Substance:46504892 PubChem Compound:3561 BindingDB:50194601 Drugs.com:http://www.drugs.com/mtm/haloprogin-topical.html ChemSpider:3440 PharmGKB:PA164768737 |
|
subClassOf |