Preferred Name |
benzyl benzoate |
|
Synonyms |
C14H12O2 benzyl benzoate |
|
ID |
http://purl.obolibrary.org/obo/dinto_DB00676 |
|
ATCCode |
P03AX01 |
|
CASRN |
120-51-4 |
|
DBBrand |
benylate benzylester kyseliny benzoove scobenol benzyl alcohol benzoic ester scabiozon scabide benzyl ester benzoic acid, benzyl ester scabagen benzoic acid benzyl ester benzylets benzyl phenylformate benzoic acid, phenylmethyl ester vanzoate ascabiol venzonate ascabin novoscabin colebenz venzoate benzyl benzoate 99+ % scabitox peruscabin scabanca benzyl benzenecarboxylate |
|
Definition |
Benzyl benzoate is one of the older preparations used to treat scabies. Scabies is a skin infection caused by the mite sarcoptes scabiei. It is characterised by severe itching (particularly at night), red spots, and may lead to a secondary infection. Benzyl benzoate is lethal to this mite and so is useful in the treatment of scabies. It is also used to treat lice infestation of the head and body. Benzyl benzoate is not the treatment of choice for scabies due to its irritant properties. |
|
InChI |
InChI=1S/C14H12O2/c15-14(13-9-5-2-6-10-13)16-11-12-7-3-1-4-8-12/h1-10H,11H2 |
|
InChIKey |
InChIKey=SESFRYSPDFLNCH-UHFFFAOYSA-N |
|
label |
benzyl benzoate |
|
prefixIRI |
obo2:dinto_DB00676 |
|
prefLabel |
benzyl benzoate |
|
SMILES |
O=C(OCC1=CC=CC=C1)C1=CC=CC=C1 |
|
Synonym |
C14H12O2 benzyl benzoate |
|
xref |
PubChem Substance:46508023 PharmGKB:PA164748881 PubChem Compound:2345 Drugs.com:http://www.drugs.com/cons/benzyl-benzoate-topical.html ChemSpider:13856959 |
|
subClassOf |