loading...| Preferred Name |
phosphatidylserine |
|
| Synonyms |
(2S)-2-amino-3-({[(2R)-2-(butanoyloxy)-3-(propanoyloxy)propoxy](hydroxy)phosphoryl}oxy)propanoic acid C13H24NO10P |
|
| ID |
http://purl.obolibrary.org/obo/dinto_DB00144 |
|
| CASRN |
8002-43-5 |
|
| DBBrand |
lifeextension ps caps |
|
| DBSynonym |
o3-phosphatidyl-l-serine phosphatidyl-l-serine 3-o-sn-phosphatidyl-l-serine |
|
| Definition |
Phosphatidylserine (PS) is a phospholipid nutrient found in fish, green leafy vegetables, soybeans and rice, and is essential for the normal functioning of neuronal cell membranes and activates Protein kinase C (PKC) which has been shown to be involved in memory function. In apoptosis, phosphatidylserine is transferred to the outer leaflet of the plasma membrane. This is part of the process by which the cell is targeted for phagocytosis. PS has been shown to slow cognitive decline in animal models. PS has been investigated in a small number of double-blind placebo trials and has been shown to increase memory performance in the elderly. Because of the potentail cognitive benefits of phosphatidylserine, the substance is sold as a dietary supplement to people who believe they can benefit from an increased intake. The dietary supplement was originally processed from bovine sources however Prion disease scares in the 1990s outlawed this process, and a soy-based alternative was adopted. |
|
| InChI |
InChI=1S/C13H24NO10P/c1-3-5-12(16)24-9(6-21-11(15)4-2)7-22-25(19,20)23-8-10(14)13(17)18/h9-10H,3-8,14H2,1-2H3,(H,17,18)(H,19,20)/t9-,10+/m1/s1 |
|
| InChIKey |
InChIKey=UNJJBGNPUUVVFQ-ZJUUUORDSA-N |
|
| label |
phosphatidylserine |
|
| prefixIRI |
obo2:dinto_DB00144 |
|
| prefLabel |
phosphatidylserine |
|
| related with |
http://purl.obolibrary.org/obo/dinto_1652 http://purl.obolibrary.org/obo/dinto_1492 http://purl.obolibrary.org/obo/dinto_1498 http://purl.obolibrary.org/obo/dinto_4062 http://purl.obolibrary.org/obo/dinto_3320 http://purl.obolibrary.org/obo/dinto_1211 http://purl.obolibrary.org/obo/dinto_2014 http://purl.obolibrary.org/obo/dinto_1501 |
|
| SMILES |
CCCC(=O)O[C@H](COC(=O)CC)COP(O)(=O)OC[C@H](N)C(O)=O |
|
| Synonym |
(2S)-2-amino-3-({[(2R)-2-(butanoyloxy)-3-(propanoyloxy)propoxy](hydroxy)phosphoryl}oxy)propanoic acid C13H24NO10P |
|
| xref |
PubChem Compound:6323481 PDRhealth:http://www.pdrhealth.com/drug_info/nmdrugprofiles/nutsupdrugs/pho_0202.shtml ChemSpider:13628254 Wikipedia:http://en.wikipedia.org/wiki/Phosphatidylserine PharmGKB:PA164768860 Guide To Pharmacology:3638 PDB:PSF PubChem Substance:46505650 IUPHAR:3638 ChEBI:18303 |
|
| subClassOf |